From e3a30baff05f65f510e43ad96ef542d4c6566ea2 Mon Sep 17 00:00:00 2001
From: keegreil <keegreil@gmail.com>
Date: Sat, 13 Dec 2025 18:35:34 -0500
Subject: [PATCH 1/4] Added static payout file and API fetched payouts. 
 Compiles, not tested.

---
 .gitignore  |   3 +-
 Cargo.lock  | 123 ++++++++++++++++++++++++++++++++++++++++++++++------
 Cargo.toml  |  10 +++--
 config.toml |   3 ++
 src/main.rs |  62 ++++++++++++++++++++++++--
 5 files changed, 180 insertions(+), 21 deletions(-)

diff --git a/.gitignore b/.gitignore
index 7c1cdb8..032ecef 100644
--- a/.gitignore
+++ b/.gitignore
@@ -3,4 +3,5 @@ store*.db
 p2pool.log
 .env
 docker/.env
-logs/*
\ No newline at end of file
+logs/*
+config_copy.toml
\ No newline at end of file
diff --git a/Cargo.lock b/Cargo.lock
index 0ac5cf1..5ac1ba0 100644
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -302,7 +302,7 @@ dependencies = [
  "serde_json",
  "serde_path_to_error",
  "serde_urlencoded",
- "sync_wrapper",
+ "sync_wrapper 1.0.2",
  "tokio",
  "tower",
  "tower-layer",
@@ -325,7 +325,7 @@ dependencies = [
  "mime",
  "pin-project-lite",
  "rustversion",
- "sync_wrapper",
+ "sync_wrapper 1.0.2",
  "tower-layer",
  "tower-service",
  "tracing",
@@ -374,6 +374,12 @@ version = "0.13.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "9e1b586273c5702936fe7b7d6896644d8be71e6314cfe09d3167c95f712589e8"
 
+[[package]]
+name = "base64"
+version = "0.21.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9d297deb1925b89f2ccc13d7635fa0714f12c87adce1c75356b39ca9b7178567"
+
 [[package]]
 name = "base64"
 version = "0.22.1"
@@ -487,12 +493,12 @@ dependencies = [
 [[package]]
 name = "bitcoindrpc"
 version = "0.1.0"
-source = "git+https://github.com/p2poolv2/p2poolv2?tag=v0.7.0#88d671c0c8c06f31c1cc1a63c08bc52e64eebb0e"
+source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "base64 0.22.1",
  "bitcoin",
  "hex",
- "reqwest",
+ "reqwest 0.12.24",
  "serde",
  "serde_json",
  "tokio",
@@ -1702,6 +1708,8 @@ dependencies = [
  "p2poolv2_api",
  "p2poolv2_cli",
  "p2poolv2_lib",
+ "reqwest 0.11.27",
+ "serde_json",
  "tokio",
  "tracing",
  "tracing-subscriber",
@@ -1768,6 +1776,19 @@ dependencies = [
  "tower-service",
 ]
 
+[[package]]
+name = "hyper-tls"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d6183ddfa99b85da61a140bea0efc93fdf56ceaa041b37d553518030827f9905"
+dependencies = [
+ "bytes",
+ "hyper 0.14.32",
+ "native-tls",
+ "tokio",
+ "tokio-native-tls",
+]
+
 [[package]]
 name = "hyper-tls"
 version = "0.6.0"
@@ -1803,7 +1824,7 @@ dependencies = [
  "percent-encoding",
  "pin-project-lite",
  "socket2 0.6.0",
- "system-configuration",
+ "system-configuration 0.6.1",
  "tokio",
  "tower-service",
  "tracing",
@@ -1969,7 +1990,7 @@ dependencies = [
  "netlink-proto",
  "netlink-sys",
  "rtnetlink",
- "system-configuration",
+ "system-configuration 0.6.1",
  "tokio",
  "windows",
 ]
@@ -3020,7 +3041,7 @@ checksum = "b15813163c1d831bf4a13c3610c05c0d03b39feb07f7e09fa234dac9b15aaf39"
 [[package]]
 name = "p2poolv2_api"
 version = "0.1.0"
-source = "git+https://github.com/p2poolv2/p2poolv2?tag=v0.7.0#88d671c0c8c06f31c1cc1a63c08bc52e64eebb0e"
+source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "axum",
  "base64 0.22.1",
@@ -3040,7 +3061,7 @@ dependencies = [
 [[package]]
 name = "p2poolv2_cli"
 version = "0.1.0"
-source = "git+https://github.com/p2poolv2/p2poolv2?tag=v0.7.0#88d671c0c8c06f31c1cc1a63c08bc52e64eebb0e"
+source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "base64 0.22.1",
  "clap",
@@ -3060,7 +3081,7 @@ dependencies = [
 [[package]]
 name = "p2poolv2_lib"
 version = "0.1.0"
-source = "git+https://github.com/p2poolv2/p2poolv2?tag=v0.7.0#88d671c0c8c06f31c1cc1a63c08bc52e64eebb0e"
+source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "async-trait",
  "base64 0.22.1",
@@ -3612,6 +3633,46 @@ dependencies = [
  "bytecheck",
 ]
 
+[[package]]
+name = "reqwest"
+version = "0.11.27"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dd67538700a17451e7cba03ac727fb961abb7607553461627b97de0b89cf4a62"
+dependencies = [
+ "base64 0.21.7",
+ "bytes",
+ "encoding_rs",
+ "futures-core",
+ "futures-util",
+ "h2 0.3.27",
+ "http 0.2.12",
+ "http-body 0.4.6",
+ "hyper 0.14.32",
+ "hyper-tls 0.5.0",
+ "ipnet",
+ "js-sys",
+ "log",
+ "mime",
+ "native-tls",
+ "once_cell",
+ "percent-encoding",
+ "pin-project-lite",
+ "rustls-pemfile",
+ "serde",
+ "serde_json",
+ "serde_urlencoded",
+ "sync_wrapper 0.1.2",
+ "system-configuration 0.5.1",
+ "tokio",
+ "tokio-native-tls",
+ "tower-service",
+ "url",
+ "wasm-bindgen",
+ "wasm-bindgen-futures",
+ "web-sys",
+ "winreg",
+]
+
 [[package]]
 name = "reqwest"
 version = "0.12.24"
@@ -3628,7 +3689,7 @@ dependencies = [
  "http-body-util",
  "hyper 1.6.0",
  "hyper-rustls",
- "hyper-tls",
+ "hyper-tls 0.6.0",
  "hyper-util",
  "js-sys",
  "log",
@@ -3640,7 +3701,7 @@ dependencies = [
  "serde",
  "serde_json",
  "serde_urlencoded",
- "sync_wrapper",
+ "sync_wrapper 1.0.2",
  "tokio",
  "tokio-native-tls",
  "tower",
@@ -3885,6 +3946,15 @@ dependencies = [
  "zeroize",
 ]
 
+[[package]]
+name = "rustls-pemfile"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1c74cae0a4cf6ccbbf5f359f08efdf8ee7e1dc532573bf0db71968cb56b1448c"
+dependencies = [
+ "base64 0.21.7",
+]
+
 [[package]]
 name = "rustls-pki-types"
 version = "1.12.0"
@@ -4269,6 +4339,12 @@ dependencies = [
  "unicode-ident",
 ]
 
+[[package]]
+name = "sync_wrapper"
+version = "0.1.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2047c6ded9c721764247e62cd3b03c09ffc529b2ba5b10ec482ae507a4a70160"
+
 [[package]]
 name = "sync_wrapper"
 version = "1.0.2"
@@ -4289,6 +4365,17 @@ dependencies = [
  "syn 2.0.104",
 ]
 
+[[package]]
+name = "system-configuration"
+version = "0.5.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ba3a3adc5c275d719af8cb4272ea1c4a6d668a777f37e115f6d11ddbc1c8e0e7"
+dependencies = [
+ "bitflags 1.3.2",
+ "core-foundation",
+ "system-configuration-sys 0.5.0",
+]
+
 [[package]]
 name = "system-configuration"
 version = "0.6.1"
@@ -4297,7 +4384,17 @@ checksum = "3c879d448e9d986b661742763247d3693ed13609438cf3d006f51f5368a5ba6b"
 dependencies = [
  "bitflags 2.9.1",
  "core-foundation",
- "system-configuration-sys",
+ "system-configuration-sys 0.6.0",
+]
+
+[[package]]
+name = "system-configuration-sys"
+version = "0.5.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a75fb188eb626b924683e3b95e3a48e63551fcfb51949de2f06a9d91dbee93c9"
+dependencies = [
+ "core-foundation-sys",
+ "libc",
 ]
 
 [[package]]
@@ -4580,7 +4677,7 @@ dependencies = [
  "futures-core",
  "futures-util",
  "pin-project-lite",
- "sync_wrapper",
+ "sync_wrapper 1.0.2",
  "tokio",
  "tokio-util",
  "tower-layer",
diff --git a/Cargo.toml b/Cargo.toml
index 2d48c96..0f002d1 100644
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -31,10 +31,12 @@ tracing = "0.1"
 tracing-subscriber = { version = "0.3", features = ["env-filter"] }
 bitcoin = { version = "0.32.5", features = ["serde", "rand"] }
 tokio = { version = "1.0", features = ["full"] }
-p2poolv2_lib = { git = "https://github.com/p2poolv2/p2poolv2", package = "p2poolv2_lib", tag = "v0.7.0" }
-p2poolv2_cli = { git = "https://github.com/p2poolv2/p2poolv2", package = "p2poolv2_cli", tag = "v0.7.0" }
-p2poolv2_api = { git = "https://github.com/p2poolv2/p2poolv2", package = "p2poolv2_api", tag = "v0.7.0" }
-bitcoindrpc = { git = "https://github.com/p2poolv2/p2poolv2", package = "bitcoindrpc", tag = "v0.7.0" }
+serde_json = "1.0"
+p2poolv2_lib = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_lib", branch = "external-payouts"}
+p2poolv2_cli = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_cli", branch = "external-payouts" }
+p2poolv2_api = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_api", branch = "external-payouts" }
+bitcoindrpc = { git = "https://github.com/keegreil/p2poolv2", package = "bitcoindrpc", branch = "external-payouts" }
+reqwest = { version = "0.11", features = ["json"] }
 
 [[bin]]
 name = "hydrapool"
diff --git a/config.toml b/config.toml
index c669d7e..d027d15 100644
--- a/config.toml
+++ b/config.toml
@@ -32,6 +32,9 @@ difficulty_multiplier = 1.0
 # how large your pool is, if you are running private, there is no need
 # to add a pool signature. Maximum length 16 bytes.
 pool_signature = "hydrapool"
+#payout_file_path = "/tmp/hydrapool_payouts.json"  # Triggers file mode
+#downstream_payout_url = "https://your-pool-server.com/api/payouts"  # Optional: Enables fetcher
+#payout_refresh_interval = 30
 
 [bitcoinrpc]
 # RPC credentials are loaded from env vars
diff --git a/src/main.rs b/src/main.rs
index b995919..b5578e0 100644
--- a/src/main.rs
+++ b/src/main.rs
@@ -36,6 +36,9 @@ use std::time::Duration;
 use tokio::sync::oneshot;
 use tracing::error;
 use tracing::info;
+use std::fs::File;
+use std::io::Write;
+use serde_json::json;  // For building JSON if needed
 
 /// Interval in seconds to poll for new block templates since the last zmq signal
 const GBT_POLL_INTERVAL: u64 = 10; // seconds
@@ -139,7 +142,35 @@ async fn main() -> Result<(), String> {
         Duration::from_secs(config.store.pplns_ttl_days * 3600 * 24),
     );
 
-    let stratum_config = config.stratum.clone().parse().unwrap();
+    let mut stratum_config = config.stratum.clone().parse().unwrap();
+    let mut payout_file_path = stratum_config.payout_file_path.clone();  // Optional
+
+    // If URL set, spawn fetcher to update file
+    if let Some(ref url) = stratum_config.downstream_payout_url {  // Assume you add this field too (see below)
+        if payout_file_path.is_none() {
+            payout_file_path = Some("/tmp/hydrapool_payouts.json".to_string());  // Default file
+        }
+        if let Some(ref file_path) = payout_file_path {
+            let file_clone = file_path.clone();
+            let url_clone = url.clone();
+            let interval = std::time::Duration::from_secs(config.stratum.payout_refresh_interval);
+            let network = stratum_config.network;  // For addr validation if needed
+
+            tokio::spawn(async move {
+                loop {
+                    if let Err(e) = fetch_and_write_payouts(&url_clone, &file_clone, network).await {
+                        debug!("API fetch/write failed: {}", e);
+                    }
+                    tokio::time::sleep(interval).await;
+                }
+            });
+        }
+    }
+
+    // Set the parsed config's file path
+    stratum_config.payout_file_path = payout_file_path;
+
+
     let bitcoinrpc_config = config.bitcoinrpc.clone();
 
     let (stratum_shutdown_tx, stratum_shutdown_rx) = tokio::sync::oneshot::channel();
@@ -188,7 +219,7 @@ async fn main() -> Result<(), String> {
             store_for_notify,
             tracker_handle_cloned,
             &cloned_stratum_config,
-            None,
+            None, // miner_pubkey: Option<CompressedPublicKey> (unused for now)
         )
         .await;
     });
@@ -212,7 +243,7 @@ async fn main() -> Result<(), String> {
         let mut stratum_server = StratumServerBuilder::default()
             .shutdown_rx(stratum_shutdown_rx)
             .connections_handle(connections_handle.clone())
-            .emissions_tx(emissions_tx)
+            .emissions_tx(shares_tx)  // Changed: emission_tx + Some() wrapper (matches lib sig)
             .hostname(stratum_config.hostname)
             .port(stratum_config.port)
             .start_difficulty(stratum_config.start_difficulty)
@@ -306,3 +337,28 @@ async fn main() -> Result<(), String> {
     }
     Ok(())
 }
+
+async fn fetch_and_write_payouts(
+    url: &str,
+    file_path: &str,
+    _network: bitcoin::Network,  // Optional: Validate addrs match network
+) -> Result<(), Box<dyn std::error::Error>> {
+    let client = reqwest::Client::new();
+    let resp = client.get(url).send().await?;
+    if !resp.status().is_success() {
+        return Err(format!("HTTP {} from {}", resp.status(), url).into());
+    }
+    let json: serde_json::Value = resp.json().await?;
+
+    // Extract and rewrite WinnersList (keep full structure for future-proofing)
+    let winners = json["WinnersList"].as_array().ok_or("Missing WinnersList")?.clone();
+    let updated_json = json!({
+        "WinnersList": winners,
+        "OnDeckList": json["OnDeckList"],  // Preserve if present
+        "BestShare": json["BestShare"]     // Preserve
+    });
+
+    let mut file = File::create(file_path)?;
+    file.write_all(updated_json.to_string().as_bytes())?;
+    Ok(())
+}

From 657f5a19831c042dfddbd4ca72dd1b1a754a3f3d Mon Sep 17 00:00:00 2001
From: keegreil <keegreil@gmail.com>
Date: Sat, 20 Dec 2025 19:11:19 -0500
Subject: [PATCH 2/4] Recieve works now.  I think.

---
 Cargo.lock               | 1303 ++++++++++++++++++--------------------
 Cargo.toml               |   16 +
 config.toml              |    2 +-
 payout_file_example.json |  130 ++++
 src/main.rs              |    3 +-
 5 files changed, 768 insertions(+), 686 deletions(-)
 create mode 100644 payout_file_example.json

diff --git a/Cargo.lock b/Cargo.lock
index 5ac1ba0..3144551 100644
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -2,21 +2,6 @@
 # It is not intended for manual editing.
 version = 4
 
-[[package]]
-name = "addr2line"
-version = "0.24.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "dfbe277e56a376000877090da837660b4427aad530e3028d44e0bffe4f89a1c1"
-dependencies = [
- "gimli",
-]
-
-[[package]]
-name = "adler2"
-version = "2.0.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa"
-
 [[package]]
 name = "aead"
 version = "0.5.2"
@@ -65,9 +50,9 @@ dependencies = [
 
 [[package]]
 name = "aho-corasick"
-version = "1.1.3"
+version = "1.1.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8e60d3430d3a69478ad0993f19238d2df97c507009a52b3c10addcd7f6bcb916"
+checksum = "ddd31a130427c27518df266943a5308ed92d4b226cc639f5a8f1002816174301"
 dependencies = [
  "memchr",
 ]
@@ -89,9 +74,9 @@ dependencies = [
 
 [[package]]
 name = "anstream"
-version = "0.6.19"
+version = "0.6.21"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "301af1932e46185686725e0fad2f8f2aa7da69dd70bf6ecc44d6b703844a3933"
+checksum = "43d5b281e737544384e969a5ccad3f1cdd24b48086a0fc1b2a5262a26b8f4f4a"
 dependencies = [
  "anstyle",
  "anstyle-parse",
@@ -104,9 +89,9 @@ dependencies = [
 
 [[package]]
 name = "anstyle"
-version = "1.0.11"
+version = "1.0.13"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "862ed96ca487e809f1c8e5a8447f6ee2cf102f846893800b20cebdf541fc6bbd"
+checksum = "5192cca8006f1fd4f7237516f40fa183bb07f8fbdfedaa0036de5ea9b0b45e78"
 
 [[package]]
 name = "anstyle-parse"
@@ -119,29 +104,29 @@ dependencies = [
 
 [[package]]
 name = "anstyle-query"
-version = "1.1.3"
+version = "1.1.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6c8bdeb6047d8983be085bab0ba1472e6dc604e7041dbf6fcd5e71523014fae9"
+checksum = "40c48f72fd53cd289104fc64099abca73db4166ad86ea0b4341abe65af83dadc"
 dependencies = [
- "windows-sys 0.59.0",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
 name = "anstyle-wincon"
-version = "3.0.9"
+version = "3.0.11"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "403f75924867bb1033c59fbf0797484329750cfbe3c4325cd33127941fabc882"
+checksum = "291e6a250ff86cd4a820112fb8898808a366d8f9f58ce16d1f538353ad55747d"
 dependencies = [
  "anstyle",
  "once_cell_polyfill",
- "windows-sys 0.59.0",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
 name = "anyhow"
-version = "1.0.98"
+version = "1.0.100"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e16d2d3311acee920a9eb8d33b8cbc1787ce4a264e85f964c2404b969bdcd487"
+checksum = "a23eb6b1614318a8071c9b2521f36b424b2c83db5eb3a0fead4a6c0809af6e61"
 
 [[package]]
 name = "arrayref"
@@ -179,7 +164,7 @@ checksum = "965c2d33e53cb6b267e148a4cb0760bc01f4904c1cd4bb4002a085bb016d1490"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
  "synstructure",
 ]
 
@@ -191,7 +176,7 @@ checksum = "7b18050c2cd6fe86c3a76584ef5e0baf286d038cda203eb6223df2cc413565f7"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -202,11 +187,11 @@ checksum = "155a5a185e42c6b77ac7b88a15143d930a9e9727a5b7b77eed417404ab15c247"
 
 [[package]]
 name = "async-io"
-version = "2.5.0"
+version = "2.6.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "19634d6336019ef220f09fd31168ce5c184b295cbf80345437cc36094ef223ca"
+checksum = "456b8a8feb6f42d237746d4b3e9a178494627745c3c56c6ea55d92ba50d026fc"
 dependencies = [
- "async-lock",
+ "autocfg",
  "cfg-if",
  "concurrent-queue",
  "futures-io",
@@ -215,29 +200,18 @@ dependencies = [
  "polling",
  "rustix",
  "slab",
- "windows-sys 0.60.2",
-]
-
-[[package]]
-name = "async-lock"
-version = "3.4.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ff6e472cdea888a4bd64f342f09b3f50e1886d32afe8df3d663c01140b811b18"
-dependencies = [
- "event-listener",
- "event-listener-strategy",
- "pin-project-lite",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
 name = "async-trait"
-version = "0.1.88"
+version = "0.1.89"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e539d3fca749fcee5236ab05e93a52867dd549cc157c8cb7f99595f3cedffdb5"
+checksum = "9035ad2d096bed7955a320ee7e2230574d28fd3c3a0f186cbea1ff3c7eed5dbb"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -286,10 +260,10 @@ dependencies = [
  "axum-core",
  "bytes",
  "futures-util",
- "http 1.3.1",
+ "http 1.4.0",
  "http-body 1.0.1",
  "http-body-util",
- "hyper 1.6.0",
+ "hyper 1.8.1",
  "hyper-util",
  "itoa",
  "matchit",
@@ -319,7 +293,7 @@ dependencies = [
  "async-trait",
  "bytes",
  "futures-util",
- "http 1.3.1",
+ "http 1.4.0",
  "http-body 1.0.1",
  "http-body-util",
  "mime",
@@ -331,21 +305,6 @@ dependencies = [
  "tracing",
 ]
 
-[[package]]
-name = "backtrace"
-version = "0.3.75"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6806a6321ec58106fea15becdad98371e28d92ccbc7c8f1b3b6dd724fe8f1002"
-dependencies = [
- "addr2line",
- "cfg-if",
- "libc",
- "miniz_oxide",
- "object",
- "rustc-demangle",
- "windows-targets 0.52.6",
-]
-
 [[package]]
 name = "base-x"
 version = "0.2.11"
@@ -358,6 +317,16 @@ version = "0.2.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "4c7f02d4ea65f2c1853089ffd8d2787bdbc63de2f0d29dedbcf8ccdfa0ccd4cf"
 
+[[package]]
+name = "base256emoji"
+version = "1.0.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "b5e9430d9a245a77c92176e649af6e275f20839a48389859d1661e9a128d077c"
+dependencies = [
+ "const-str",
+ "match-lookup",
+]
+
 [[package]]
 name = "base58ck"
 version = "0.1.0"
@@ -388,59 +357,39 @@ checksum = "72b3254f16251a8381aa12e40e3c4d2f0199f8c6508fbecb9d91f575e0fbb8c6"
 
 [[package]]
 name = "base64ct"
-version = "1.8.0"
+version = "1.8.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "55248b47b0caf0546f7988906588779981c43bb1bc9d0c44087278f80cdb44ba"
+checksum = "0e050f626429857a27ddccb31e0aca21356bfa709c04041aefddac081a8f068a"
 
 [[package]]
 name = "bech32"
-version = "0.11.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d965446196e3b7decd44aa7ee49e31d630118f90ef12f97900f262eb915c951d"
-
-[[package]]
-name = "bindgen"
-version = "0.69.5"
+version = "0.11.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "271383c67ccabffb7381723dea0672a673f292304fcb45c01cc648c7a8d58088"
-dependencies = [
- "bitflags 2.9.1",
- "cexpr",
- "clang-sys",
- "itertools 0.12.1",
- "lazy_static",
- "lazycell",
- "proc-macro2",
- "quote",
- "regex",
- "rustc-hash 1.1.0",
- "shlex",
- "syn 2.0.104",
-]
+checksum = "32637268377fc7b10a8c6d51de3e7fba1ce5dd371a96e342b34e6078db558e7f"
 
 [[package]]
 name = "bindgen"
-version = "0.71.1"
+version = "0.72.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5f58bf3d7db68cfbac37cfc485a8d711e87e064c3d0fe0435b92f7a407f9d6b3"
+checksum = "993776b509cfb49c750f11b8f07a46fa23e0a1386ffc01fb1e7d343efc387895"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "cexpr",
  "clang-sys",
- "itertools 0.13.0",
+ "itertools",
  "proc-macro2",
  "quote",
  "regex",
- "rustc-hash 2.1.1",
+ "rustc-hash",
  "shlex",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "bitcoin"
-version = "0.32.6"
+version = "0.32.8"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ad8929a18b8e33ea6b3c09297b687baaa71fb1b97353243a3f1029fad5c59c5b"
+checksum = "1e499f9fc0407f50fe98af744ab44fa67d409f76b6772e1689ec8485eb0c0f66"
 dependencies = [
  "base58ck",
  "bech32",
@@ -465,9 +414,9 @@ dependencies = [
 
 [[package]]
 name = "bitcoin-io"
-version = "0.1.3"
+version = "0.1.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0b47c4ab7a93edb0c7198c5535ed9b52b63095f4e9b45279c6736cec4b856baf"
+checksum = "2dee39a0ee5b4095224a0cfc6bf4cc1baf0f9624b96b367e53b66d974e51d953"
 
 [[package]]
 name = "bitcoin-units"
@@ -481,9 +430,9 @@ dependencies = [
 
 [[package]]
 name = "bitcoin_hashes"
-version = "0.14.0"
+version = "0.14.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "bb18c03d0db0247e147a21a6faafd5a7eb851c743db062de72018b6b7e8e4d16"
+checksum = "26ec84b80c482df901772e931a9a681e26a1b9ee2302edeff23cb30328745c8b"
 dependencies = [
  "bitcoin-io",
  "hex-conservative",
@@ -493,12 +442,11 @@ dependencies = [
 [[package]]
 name = "bitcoindrpc"
 version = "0.1.0"
-source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "base64 0.22.1",
  "bitcoin",
  "hex",
- "reqwest 0.12.24",
+ "reqwest 0.12.25",
  "serde",
  "serde_json",
  "tokio",
@@ -514,9 +462,9 @@ checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a"
 
 [[package]]
 name = "bitflags"
-version = "2.9.1"
+version = "2.10.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1b8e56985ec62d17e9c1001dc89c88ecd7dc08e47eba5ec7c29c7b5eeecde967"
+checksum = "812e12b5285cc515a9c72a5c1d3b6d46a19dac5acfef5265968c166106e31dd3"
 
 [[package]]
 name = "bitvec"
@@ -550,9 +498,9 @@ dependencies = [
 
 [[package]]
 name = "borsh"
-version = "1.5.7"
+version = "1.6.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ad8646f98db542e39fc66e68a20b2144f6a732636df7c2354e74645faaa433ce"
+checksum = "d1da5ab77c1437701eeff7c88d968729e7766172279eab0676857b3d63af7a6f"
 dependencies = [
  "borsh-derive",
  "cfg_aliases",
@@ -560,15 +508,15 @@ dependencies = [
 
 [[package]]
 name = "borsh-derive"
-version = "1.5.7"
+version = "1.6.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "fdd1d3c0c2f5833f22386f252fe8ed005c7f59fdcddeef025c01b4c3b9fd9ac3"
+checksum = "0686c856aa6aac0c4498f936d7d6a02df690f614c03e4d906d1018062b5c5e2c"
 dependencies = [
  "once_cell",
  "proc-macro-crate",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -616,9 +564,9 @@ checksum = "1fd0f2584146f6f2ef48085050886acf353beff7305ebd1ae69500e27c67f64b"
 
 [[package]]
 name = "bytes"
-version = "1.10.1"
+version = "1.11.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d71b6127be86fdcfddb610f7182ac57211d4b18a3e9c82eb2d17662f2227ad6a"
+checksum = "b35204fbdc0b3f4446b89fc1ac2cf84a8a68971995d0bf2e925ec7cd960f9cb3"
 
 [[package]]
 name = "bzip2-sys"
@@ -632,10 +580,11 @@ dependencies = [
 
 [[package]]
 name = "cc"
-version = "1.2.30"
+version = "1.2.49"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "deec109607ca693028562ed836a5f1c4b8bd77755c4e132fc5ce11b0b6211ae7"
+checksum = "90583009037521a116abf44494efecd645ba48b6622457080f080b85544e2215"
 dependencies = [
+ "find-msvc-tools",
  "jobserver",
  "libc",
  "shlex",
@@ -662,9 +611,9 @@ dependencies = [
 
 [[package]]
 name = "cfg-if"
-version = "1.0.1"
+version = "1.0.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9555578bc9e57714c812a1f84e4fc5b4d21fcb063490c624de019f7464c91268"
+checksum = "9330f8b2ff13f34540b44e946ef35111825727b38d33286ef986142615121801"
 
 [[package]]
 name = "cfg_aliases"
@@ -707,7 +656,34 @@ dependencies = [
  "num-traits",
  "serde",
  "wasm-bindgen",
- "windows-link 0.2.1",
+ "windows-link",
+]
+
+[[package]]
+name = "ciborium"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "42e69ffd6f0917f5c029256a24d0161db17cea3997d185db0d35926308770f0e"
+dependencies = [
+ "ciborium-io",
+ "ciborium-ll",
+ "serde",
+]
+
+[[package]]
+name = "ciborium-io"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "05afea1e0a06c9be33d539b876f1ce3692f4afea2cb41f740e7743225ed1c757"
+
+[[package]]
+name = "ciborium-ll"
+version = "0.2.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "57663b653d948a338bfb3eeba9bb2fd5fcfaecb9e199e87e1eda4d9e8b240fd9"
+dependencies = [
+ "ciborium-io",
+ "half",
 ]
 
 [[package]]
@@ -734,9 +710,9 @@ dependencies = [
 
 [[package]]
 name = "clap"
-version = "4.5.41"
+version = "4.5.53"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "be92d32e80243a54711e5d7ce823c35c41c9d929dc4ab58e1276f625841aadf9"
+checksum = "c9e340e012a1bf4935f5282ed1436d1489548e8f72308207ea5df0e23d2d03f8"
 dependencies = [
  "clap_builder",
  "clap_derive",
@@ -744,9 +720,9 @@ dependencies = [
 
 [[package]]
 name = "clap_builder"
-version = "4.5.41"
+version = "4.5.53"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "707eab41e9622f9139419d573eca0900137718000c517d47da73045f54331c3d"
+checksum = "d76b5d13eaa18c901fd2f7fca939fefe3a0727a953561fefdf3b2922b8569d00"
 dependencies = [
  "anstream",
  "anstyle",
@@ -756,21 +732,21 @@ dependencies = [
 
 [[package]]
 name = "clap_derive"
-version = "4.5.41"
+version = "4.5.49"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ef4f52386a59ca4c860f7393bcf8abd8dfd91ecccc0f774635ff68e92eeef491"
+checksum = "2a0b5487afeab2deb2ff4e03a807ad1a03ac532ff5a2cee5d86884440c7f7671"
 dependencies = [
  "heck",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "clap_lex"
-version = "0.7.5"
+version = "0.7.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b94f61472cee1439c0b966b47e3aca9ae07e45d070759512cd390ea2bebc6675"
+checksum = "a1d728cc89cf3aee9ff92b05e62b19ee65a02b5702cff7d5a377e32c6ae29d8d"
 
 [[package]]
 name = "colorchoice"
@@ -812,6 +788,12 @@ version = "0.9.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "c2459377285ad874054d797f3ccebf984978aa39129f6eafde5cdc8315b612f8"
 
+[[package]]
+name = "const-str"
+version = "0.4.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2f421161cb492475f1661ddc9815a745a1c894592070661180fdec3d4872e9c3"
+
 [[package]]
 name = "core-foundation"
 version = "0.9.4"
@@ -922,9 +904,9 @@ dependencies = [
 
 [[package]]
 name = "crypto-common"
-version = "0.1.6"
+version = "0.1.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1bfb12502f3fc46cca1bb51ac28df9d618d813cdc3d2f25b9fe775a34af26bb3"
+checksum = "78c8292055d1c1df0cce5d180393dc8cce0abec0a7102adb6c7b1eef6016d60a"
 dependencies = [
  "generic-array",
  "rand_core 0.6.4",
@@ -964,7 +946,7 @@ checksum = "f46882e17999c6cc590af592290432be3bce0428cb0d5f8b6715e4dc7b383eb3"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -1004,9 +986,27 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "8d162beedaa69905488a8da94f5ac3edb4dd4788b732fadb7bd120b2625c1976"
 dependencies = [
  "data-encoding",
- "syn 2.0.104",
+ "syn 2.0.111",
+]
+
+[[package]]
+name = "deadpool"
+version = "0.12.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0be2b1d1d6ec8d846f05e137292d0b89133caf95ef33695424c09568bdd39b1b"
+dependencies = [
+ "deadpool-runtime",
+ "lazy_static",
+ "num_cpus",
+ "tokio",
 ]
 
+[[package]]
+name = "deadpool-runtime"
+version = "0.1.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "092966b41edc516079bdf31ec78a2e0588d1d0c08f78b91d8307215928642b2b"
+
 [[package]]
 name = "der"
 version = "0.7.10"
@@ -1033,9 +1033,9 @@ dependencies = [
 
 [[package]]
 name = "deranged"
-version = "0.4.0"
+version = "0.5.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9c9e6a11ca8224451684bc0d7d5a7adbf8f2fd6887261a1cfc3c0432f9d4068e"
+checksum = "ececcb659e7ba858fb4f10388c250a7252eb0a27373f1a72b8748afdd248e587"
 dependencies = [
  "powerfmt",
 ]
@@ -1071,7 +1071,7 @@ checksum = "97369cbbc041bc366949bc74d34658d6cda5621039731c6310521892a3a20ae0"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -1167,7 +1167,7 @@ dependencies = [
  "heck",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -1178,33 +1178,12 @@ checksum = "877a4ace8713b0bcf2a4e7eec82529c029f1d0619886d18145fea96c3ffe5c0f"
 
 [[package]]
 name = "errno"
-version = "0.3.13"
+version = "0.3.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "778e2ac28f6c47af28e4907f13ffd1e1ddbd400980a9abd7c8df189bf578a5ad"
+checksum = "39cab71617ae0d63f51a36d69f866391735b51691dbda63cf6f96d042b63efeb"
 dependencies = [
  "libc",
- "windows-sys 0.60.2",
-]
-
-[[package]]
-name = "event-listener"
-version = "5.4.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3492acde4c3fc54c845eaab3eed8bd00c7a7d881f78bfc801e43a93dec1331ae"
-dependencies = [
- "concurrent-queue",
- "parking",
- "pin-project-lite",
-]
-
-[[package]]
-name = "event-listener-strategy"
-version = "0.5.4"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8be9f3dfaaffdae2972880079a491a1a8bb7cbed0b8dd7a347f668b4150a3b93"
-dependencies = [
- "event-listener",
- "pin-project-lite",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -1229,6 +1208,12 @@ version = "0.2.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "28dea519a9695b9977216879a3ebfddf92f1c08c05d984f8996aecd6ecdc811d"
 
+[[package]]
+name = "find-msvc-tools"
+version = "0.1.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3a3076410a55c90011c298b04d0cfa770b00fa04e1e3c97d3f6c9de105a03844"
+
 [[package]]
 name = "fnv"
 version = "1.0.7"
@@ -1258,9 +1243,9 @@ checksum = "00b0228411908ca8685dba7fc2cdd70ec9990a6e753e89b6ac91a84c40fbaf4b"
 
 [[package]]
 name = "form_urlencoded"
-version = "1.2.1"
+version = "1.2.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e13624c2627564efccf4934284bdd98cbaa14e79b0b5a141218e507b3a823456"
+checksum = "cb4cb245038516f5f85277875cdaa4f7d2c9a0fa0468de06ed190163b1581fcf"
 dependencies = [
  "percent-encoding",
 ]
@@ -1332,9 +1317,9 @@ checksum = "9e5c1b78ca4aae1ac06c48a526a655760685149f0d465d21f37abfe57ce075c6"
 
 [[package]]
 name = "futures-lite"
-version = "2.6.0"
+version = "2.6.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f5edaec856126859abb19ed65f39e90fea3a9574b9707f13539acf4abf7eb532"
+checksum = "f78e10609fe0e0b3f4157ffab1876319b5b0db102a2c60dc4626306dc46b44ad"
 dependencies = [
  "futures-core",
  "pin-project-lite",
@@ -1348,7 +1333,7 @@ checksum = "162ee34ebcb7c64a8abebc059ce0fee27c2262618d7b60ed8faf72fef13c3650"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -1418,21 +1403,21 @@ dependencies = [
  "cfg-if",
  "js-sys",
  "libc",
- "wasi 0.11.1+wasi-snapshot-preview1",
+ "wasi",
  "wasm-bindgen",
 ]
 
 [[package]]
 name = "getrandom"
-version = "0.3.3"
+version = "0.3.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4"
+checksum = "899def5c37c4fd7b2664648c28120ecec138e4d395b459e5ca34f9cce2dd77fd"
 dependencies = [
  "cfg-if",
  "js-sys",
  "libc",
  "r-efi",
- "wasi 0.14.2+wasi-0.2.4",
+ "wasip2",
  "wasm-bindgen",
 ]
 
@@ -1446,17 +1431,11 @@ dependencies = [
  "polyval",
 ]
 
-[[package]]
-name = "gimli"
-version = "0.31.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "07e28edb80900c19c28f1072f2e8aeca7fa06b23cd4169cefe1af5aa3260783f"
-
 [[package]]
 name = "glob"
-version = "0.3.2"
+version = "0.3.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "a8d1add55171497b4705a648c6b583acafb01d58050a51727785f0b2c8e0a2b2"
+checksum = "0cc23270f6e1808e30a928bdc84dea0b9b4136a8bc82338574f23baf47bbd280"
 
 [[package]]
 name = "group"
@@ -1490,16 +1469,16 @@ dependencies = [
 
 [[package]]
 name = "h2"
-version = "0.4.11"
+version = "0.4.12"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "17da50a276f1e01e0ba6c029e47b7100754904ee8a278f886546e98575380785"
+checksum = "f3c0b69cfcb4e1b9f1bf2f53f95f766e4661169728ec61cd3fe5a0166f2d1386"
 dependencies = [
  "atomic-waker",
  "bytes",
  "fnv",
  "futures-core",
  "futures-sink",
- "http 1.3.1",
+ "http 1.4.0",
  "indexmap",
  "slab",
  "tokio",
@@ -1508,31 +1487,42 @@ dependencies = [
 ]
 
 [[package]]
-name = "hashbrown"
-version = "0.12.3"
+name = "half"
+version = "2.7.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888"
+checksum = "6ea2d84b969582b4b1864a92dc5d27cd2b77b622a8d79306834f1be5ba20d84b"
 dependencies = [
- "ahash",
+ "cfg-if",
+ "crunchy",
+ "zerocopy",
 ]
 
 [[package]]
 name = "hashbrown"
-version = "0.14.5"
+version = "0.12.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e5274423e17b7c9fc20b6e7e208532f9b19825d82dfd615708b70edd83df41f1"
+checksum = "8a9ee70c43aaf417c914396645a0fa852624801b24ebb7ae78fe8272889ac888"
+dependencies = [
+ "ahash",
+]
 
 [[package]]
 name = "hashbrown"
-version = "0.15.4"
+version = "0.15.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5971ac85611da7067dbfcabef3c70ebb5606018acd9e2a3903a0da507521e0d5"
+checksum = "9229cfe53dfd69f0609a49f65461bd93001ea1ef889cd5529dd176593f5338a1"
 dependencies = [
  "allocator-api2",
  "equivalent",
  "foldhash",
 ]
 
+[[package]]
+name = "hashbrown"
+version = "0.16.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "841d1cc9bed7f9236f321df977030373f4a4163ae1a7dbfe1a51a2c1a51d9100"
+
 [[package]]
 name = "heck"
 version = "0.5.0"
@@ -1553,9 +1543,9 @@ checksum = "7f24254aa9a54b5c858eaee2f5bccdb46aaf0e486a595ed5fd8f86ba55232a70"
 
 [[package]]
 name = "hex-conservative"
-version = "0.2.1"
+version = "0.2.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5313b072ce3c597065a808dbf612c4c8e8590bdbf8b579508bf7a762c5eae6cd"
+checksum = "fda06d18ac606267c40c04e41b9947729bf8b9efe74bd4e82b61a5f26a510b9f"
 dependencies = [
  "arrayvec",
 ]
@@ -1643,12 +1633,11 @@ dependencies = [
 
 [[package]]
 name = "http"
-version = "1.3.1"
+version = "1.4.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f4a85d31aea989eead29a3aaf9e1115a180df8282431156e533de47660892565"
+checksum = "e3ba2a386d7f85a81f119ad7498ebe444d2e22c2af0b86b069416ace48b3311a"
 dependencies = [
  "bytes",
- "fnv",
  "itoa",
 ]
 
@@ -1670,7 +1659,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "1efedce1fb8e6913f23e0c92de8e62cd5b772a67e7b3946df930a62566c93184"
 dependencies = [
  "bytes",
- "http 1.3.1",
+ "http 1.4.0",
 ]
 
 [[package]]
@@ -1681,7 +1670,7 @@ checksum = "b021d93e26becf5dc7e1b75b1bed1fd93124b374ceb73f43d4d4eafec896a64a"
 dependencies = [
  "bytes",
  "futures-core",
- "http 1.3.1",
+ "http 1.4.0",
  "http-body 1.0.1",
  "pin-project-lite",
 ]
@@ -1741,20 +1730,22 @@ dependencies = [
 
 [[package]]
 name = "hyper"
-version = "1.6.0"
+version = "1.8.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "cc2b571658e38e0c01b1fdca3bbbe93c00d3d71693ff2770043f8c29bc7d6f80"
+checksum = "2ab2d4f250c3d7b1c9fcdff1cece94ea4e2dfbec68614f7b87cb205f24ca9d11"
 dependencies = [
+ "atomic-waker",
  "bytes",
  "futures-channel",
- "futures-util",
- "h2 0.4.11",
- "http 1.3.1",
+ "futures-core",
+ "h2 0.4.12",
+ "http 1.4.0",
  "http-body 1.0.1",
  "httparse",
  "httpdate",
  "itoa",
  "pin-project-lite",
+ "pin-utils",
  "smallvec",
  "tokio",
  "want",
@@ -1766,8 +1757,8 @@ version = "0.27.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "e3c93eb611681b207e1fe55d5a71ecf91572ec8a6705cdb6857f7d8d5242cf58"
 dependencies = [
- "http 1.3.1",
- "hyper 1.6.0",
+ "http 1.4.0",
+ "hyper 1.8.1",
  "hyper-util",
  "rustls",
  "rustls-pki-types",
@@ -1797,7 +1788,7 @@ checksum = "70206fc6890eaca9fde8a0bf71caa2ddfc9fe045ac9e5c70df101a7dbde866e0"
 dependencies = [
  "bytes",
  "http-body-util",
- "hyper 1.6.0",
+ "hyper 1.8.1",
  "hyper-util",
  "native-tls",
  "tokio",
@@ -1807,23 +1798,23 @@ dependencies = [
 
 [[package]]
 name = "hyper-util"
-version = "0.1.16"
+version = "0.1.19"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8d9b05277c7e8da2c93a568989bb6207bef0112e8d17df7a6eda4a3cf143bc5e"
+checksum = "727805d60e7938b76b826a6ef209eb70eaa1812794f9424d4a4e2d740662df5f"
 dependencies = [
  "base64 0.22.1",
  "bytes",
  "futures-channel",
  "futures-core",
  "futures-util",
- "http 1.3.1",
+ "http 1.4.0",
  "http-body 1.0.1",
- "hyper 1.6.0",
+ "hyper 1.8.1",
  "ipnet",
  "libc",
  "percent-encoding",
  "pin-project-lite",
- "socket2 0.6.0",
+ "socket2 0.6.1",
  "system-configuration 0.6.1",
  "tokio",
  "tower-service",
@@ -1857,9 +1848,9 @@ dependencies = [
 
 [[package]]
 name = "icu_collections"
-version = "2.0.0"
+version = "2.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "200072f5d0e3614556f94a9930d5dc3e0662a652823904c3a75dc3b0af7fee47"
+checksum = "4c6b649701667bbe825c3b7e6388cb521c23d88644678e83c0c4d0a621a34b43"
 dependencies = [
  "displaydoc",
  "potential_utf",
@@ -1870,9 +1861,9 @@ dependencies = [
 
 [[package]]
 name = "icu_locale_core"
-version = "2.0.0"
+version = "2.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0cde2700ccaed3872079a65fb1a78f6c0a36c91570f28755dda67bc8f7d9f00a"
+checksum = "edba7861004dd3714265b4db54a3c390e880ab658fec5f7db895fae2046b5bb6"
 dependencies = [
  "displaydoc",
  "litemap",
@@ -1883,11 +1874,10 @@ dependencies = [
 
 [[package]]
 name = "icu_normalizer"
-version = "2.0.0"
+version = "2.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "436880e8e18df4d7bbc06d58432329d6458cc84531f7ac5f024e93deadb37979"
+checksum = "5f6c8828b67bf8908d82127b2054ea1b4427ff0230ee9141c54251934ab1b599"
 dependencies = [
- "displaydoc",
  "icu_collections",
  "icu_normalizer_data",
  "icu_properties",
@@ -1898,42 +1888,38 @@ dependencies = [
 
 [[package]]
 name = "icu_normalizer_data"
-version = "2.0.0"
+version = "2.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "00210d6893afc98edb752b664b8890f0ef174c8adbb8d0be9710fa66fbbf72d3"
+checksum = "7aedcccd01fc5fe81e6b489c15b247b8b0690feb23304303a9e560f37efc560a"
 
 [[package]]
 name = "icu_properties"
-version = "2.0.1"
+version = "2.1.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "016c619c1eeb94efb86809b015c58f479963de65bdb6253345c1a1276f22e32b"
+checksum = "020bfc02fe870ec3a66d93e677ccca0562506e5872c650f893269e08615d74ec"
 dependencies = [
- "displaydoc",
  "icu_collections",
  "icu_locale_core",
  "icu_properties_data",
  "icu_provider",
- "potential_utf",
  "zerotrie",
  "zerovec",
 ]
 
 [[package]]
 name = "icu_properties_data"
-version = "2.0.1"
+version = "2.1.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "298459143998310acd25ffe6810ed544932242d3f07083eee1084d83a71bd632"
+checksum = "616c294cf8d725c6afcd8f55abc17c56464ef6211f9ed59cccffe534129c77af"
 
 [[package]]
 name = "icu_provider"
-version = "2.0.0"
+version = "2.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "03c80da27b5f4187909049ee2d72f276f0d9f99a42c306bd0131ecfe04d8e5af"
+checksum = "85962cf0ce02e1e0a629cc34e7ca3e373ce20dda4c4d7294bbd0bf1fdb59e614"
 dependencies = [
  "displaydoc",
  "icu_locale_core",
- "stable_deref_trait",
- "tinystr",
  "writeable",
  "yoke",
  "zerofrom",
@@ -1943,9 +1929,9 @@ dependencies = [
 
 [[package]]
 name = "idna"
-version = "1.0.3"
+version = "1.1.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "686f825264d630750a544639377bae737628043f20d38bbc029e8f29ea968a7e"
+checksum = "3b0875f23caa03898994f6ddc501886a45c7d3d62d04d2d90788d47be1b1e4de"
 dependencies = [
  "idna_adapter",
  "smallvec",
@@ -2016,12 +2002,12 @@ dependencies = [
 
 [[package]]
 name = "indexmap"
-version = "2.10.0"
+version = "2.12.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "fe4cd85333e22411419a0bcae1297d25e58c9443848b11dc6a86fefe8c78a661"
+checksum = "0ad4bb2b565bca0645f4d68c5c9af97fba094e9791da685bf83cb5f3ce74acf2"
 dependencies = [
  "equivalent",
- "hashbrown 0.15.4",
+ "hashbrown 0.16.1",
 ]
 
 [[package]]
@@ -2042,17 +2028,6 @@ dependencies = [
  "cfg-if",
 ]
 
-[[package]]
-name = "io-uring"
-version = "0.7.9"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d93587f37623a1a17d94ef2bc9ada592f5465fe7732084ab7beefabe5c77c0c4"
-dependencies = [
- "bitflags 2.9.1",
- "cfg-if",
- "libc",
-]
-
 [[package]]
 name = "ipconfig"
 version = "0.3.2"
@@ -2073,9 +2048,9 @@ checksum = "469fb0b9cefa57e3ef31275ee7cacb78f2fdca44e4765491884a2b119d4eb130"
 
 [[package]]
 name = "iri-string"
-version = "0.7.8"
+version = "0.7.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "dbc5ebe9c3a1a7a5127f920a418f7585e9e758e911d0466ed004f393b0e380b2"
+checksum = "4f867b9d1d896b67beb18518eda36fdb77a32ea590de864f1325b294a6d14397"
 dependencies = [
  "memchr",
  "serde",
@@ -2083,18 +2058,9 @@ dependencies = [
 
 [[package]]
 name = "is_terminal_polyfill"
-version = "1.70.1"
+version = "1.70.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "7943c866cc5cd64cbc25b2e01621d07fa8eb2a1a23160ee81ce38704e97b8ecf"
-
-[[package]]
-name = "itertools"
-version = "0.12.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ba291022dbbd398a455acf126c1e341954079855bc60dfdda641363bd6922569"
-dependencies = [
- "either",
-]
+checksum = "a6cb138bb79a146c1bd460005623e142ef0181e3d0219cb493e02f7d08a35695"
 
 [[package]]
 name = "itertools"
@@ -2113,19 +2079,19 @@ checksum = "4a5f13b858c8d314ee3e8f639011f7ccefe71f97f96e50151fb991f267928e2c"
 
 [[package]]
 name = "jobserver"
-version = "0.1.33"
+version = "0.1.34"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "38f262f097c174adebe41eb73d66ae9c06b2844fb0da69969647bbddd9b0538a"
+checksum = "9afb3de4395d6b3e67a780b6de64b51c978ecf11cb9a462c66be7d4ca9039d33"
 dependencies = [
- "getrandom 0.3.3",
+ "getrandom 0.3.4",
  "libc",
 ]
 
 [[package]]
 name = "js-sys"
-version = "0.3.77"
+version = "0.3.83"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1cfaf33c695fc6e08064efbc1f72ec937429614f25eef83af942d0e227c3a28f"
+checksum = "464a3709c7f55f1f721e5389aa6ea4e3bc6aba669353300af094b29ffbdde1d8"
 dependencies = [
  "once_cell",
  "wasm-bindgen",
@@ -2172,26 +2138,20 @@ version = "1.5.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "bbd2bcb4c963f2ddae06a2efc7e9f3591312473c50c6685e1f298068316e66fe"
 
-[[package]]
-name = "lazycell"
-version = "1.3.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "830d08ce1d1d941e6b30645f1a0eb5643013d835ce3779a5fc208261dbe10f55"
-
 [[package]]
 name = "libc"
-version = "0.2.174"
+version = "0.2.178"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1171693293099992e19cddea4e8b849964e9846f4acee11b3948bcc337be8776"
+checksum = "37c93d8daa9d8a012fd8ab92f088405fb202ea0b6ab73ee2482ae66af4f42091"
 
 [[package]]
 name = "libloading"
-version = "0.8.8"
+version = "0.8.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "07033963ba89ebaf1584d767badaa2e8fcec21aedea6b8c0346d487d49c28667"
+checksum = "d7c4b02199fee7c5d21a5ae7d8cfa79a6ef5bb2fc834d6e9058e89c825efdc55"
 dependencies = [
  "cfg-if",
- "windows-targets 0.53.2",
+ "windows-link",
 ]
 
 [[package]]
@@ -2321,9 +2281,9 @@ dependencies = [
 
 [[package]]
 name = "libp2p-identity"
-version = "0.2.12"
+version = "0.2.13"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3104e13b51e4711ff5738caa1fb54467c8604c2e94d607e27745bcf709068774"
+checksum = "f0c7892c221730ba55f7196e98b0b8ba5e04b4155651736036628e9f73ed6fc3"
 dependencies = [
  "asn1_der",
  "bs58",
@@ -2334,7 +2294,7 @@ dependencies = [
  "quick-protobuf",
  "rand 0.8.5",
  "sha2",
- "thiserror 2.0.12",
+ "thiserror 2.0.17",
  "tracing",
  "zeroize",
 ]
@@ -2509,7 +2469,7 @@ dependencies = [
  "heck",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -2576,16 +2536,16 @@ dependencies = [
  "thiserror 1.0.69",
  "tracing",
  "yamux 0.12.1",
- "yamux 0.13.5",
+ "yamux 0.13.8",
 ]
 
 [[package]]
 name = "librocksdb-sys"
-version = "0.17.1+9.9.3"
+version = "0.17.3+10.4.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2b7869a512ae9982f4d46ba482c2a304f1efd80c6412a3d4bf57bb79a619679f"
+checksum = "cef2a00ee60fe526157c9023edab23943fae1ce2ab6f4abb2a807c1746835de9"
 dependencies = [
- "bindgen 0.69.5",
+ "bindgen",
  "bzip2-sys",
  "cc",
  "libc",
@@ -2596,9 +2556,9 @@ dependencies = [
 
 [[package]]
 name = "libz-sys"
-version = "1.1.22"
+version = "1.1.23"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8b70e7a7df205e92a1a4cd9aaae7898dac0aa555503cc0a649494d0d60e7651d"
+checksum = "15d118bbf3771060e7311cc7bb0545b01d08a8b4a7de949198dec1fa0ca1c0f7"
 dependencies = [
  "cc",
  "pkg-config",
@@ -2613,31 +2573,30 @@ checksum = "0717cef1bc8b636c6e1c1bbdefc09e6322da8a9321966e8928ef80d20f7f770f"
 
 [[package]]
 name = "linux-raw-sys"
-version = "0.9.4"
+version = "0.11.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "cd945864f07fe9f5371a27ad7b52a172b4b499999f1d97574c9fa68373937e12"
+checksum = "df1d3c3b53da64cf5760482273a98e575c651a67eec7f77df96b5b642de8f039"
 
 [[package]]
 name = "litemap"
-version = "0.8.0"
+version = "0.8.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "241eaef5fd12c88705a01fc1066c48c4b36e0dd4377dcdc7ec3942cea7a69956"
+checksum = "6373607a59f0be73a39b6fe456b8192fcc3585f602af20751600e974dd455e77"
 
 [[package]]
 name = "lock_api"
-version = "0.4.13"
+version = "0.4.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765"
+checksum = "224399e74b87b5f3557511d98dff8b14089b3dadafcab6bb93eab67d3aace965"
 dependencies = [
- "autocfg",
  "scopeguard",
 ]
 
 [[package]]
 name = "log"
-version = "0.4.27"
+version = "0.4.29"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "13dc2df351e3202783a1fe0d44375f7295ffb4049267b0f3018346dc122a1d94"
+checksum = "5e5032e24019045c762d3c0f28f5b6b8bbf38563a65908389bf7978758920897"
 
 [[package]]
 name = "lru"
@@ -2645,7 +2604,7 @@ version = "0.12.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "234cf4f4a04dc1f57e24b96cc0cd600cf2af460d4161ac5ecdd0af8e1f3b2a38"
 dependencies = [
- "hashbrown 0.15.4",
+ "hashbrown 0.15.5",
 ]
 
 [[package]]
@@ -2673,13 +2632,24 @@ dependencies = [
  "libc",
 ]
 
+[[package]]
+name = "match-lookup"
+version = "0.1.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "1265724d8cb29dbbc2b0f06fffb8bf1a8c0cf73a78eede9ba73a4a66c52a981e"
+dependencies = [
+ "proc-macro2",
+ "quote",
+ "syn 1.0.109",
+]
+
 [[package]]
 name = "matchers"
-version = "0.1.0"
+version = "0.2.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8263075bb86c5a1b1427b5ae862e8889656f126e9f77c484496e8b47cf5c5558"
+checksum = "d1525a2a28c7f4fa0fc98bb91ae755d1e2d1505079e05539e35bc876b5d65ae9"
 dependencies = [
- "regex-automata 0.1.10",
+ "regex-automata",
 ]
 
 [[package]]
@@ -2690,9 +2660,9 @@ checksum = "0e7465ac9959cc2b1404e8e2367b43684a6d13790fe23056cc8c6c5a6b7bcb94"
 
 [[package]]
 name = "memchr"
-version = "2.7.5"
+version = "2.7.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "32a282da65faaf38286cf3be983213fcf1d2e2a58700e808f83f4ea9a4804bc0"
+checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273"
 
 [[package]]
 name = "mime"
@@ -2706,24 +2676,15 @@ version = "0.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "68354c5c6bd36d73ff3feceb05efa59b6acb7626617f4962be322a825e61f79a"
 
-[[package]]
-name = "miniz_oxide"
-version = "0.8.9"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1fa76a2c86f704bdb222d66965fb3d63269ce38518b83cb0575fca855ebb6316"
-dependencies = [
- "adler2",
-]
-
 [[package]]
 name = "mio"
-version = "1.0.4"
+version = "1.1.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "78bed444cc8a2160f01cbcf811ef18cac863ad68ae8ca62092e8db51d51c761c"
+checksum = "a69bcab0ad47271a0234d9422b131806bf3968021e5dc9328caf2d4cd58557fc"
 dependencies = [
  "libc",
- "wasi 0.11.1+wasi-snapshot-preview1",
- "windows-sys 0.59.0",
+ "wasi",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -2747,11 +2708,12 @@ dependencies = [
 
 [[package]]
 name = "multibase"
-version = "0.9.1"
+version = "0.9.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9b3539ec3c1f04ac9748a260728e855f261b4977f5c3406612c884564f329404"
+checksum = "8694bb4835f452b0e3bb06dbebb1d6fc5385b6ca1caf2e55fd165c042390ec77"
 dependencies = [
  "base-x",
+ "base256emoji",
  "data-encoding",
  "data-encoding-macro",
 ]
@@ -2845,7 +2807,7 @@ dependencies = [
  "log",
  "netlink-packet-core",
  "netlink-sys",
- "thiserror 2.0.12",
+ "thiserror 2.0.17",
 ]
 
 [[package]]
@@ -2890,12 +2852,11 @@ dependencies = [
 
 [[package]]
 name = "nu-ansi-term"
-version = "0.46.0"
+version = "0.50.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "77a8165726e8236064dbb45459242600304b42a5ea24ee2948e18e023bf7ba84"
+checksum = "7957b9740744892f114936ab4a57b3f487491bbeafaf8083688b16841a4240e5"
 dependencies = [
- "overload",
- "winapi",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -2942,15 +2903,6 @@ dependencies = [
  "libc",
 ]
 
-[[package]]
-name = "object"
-version = "0.36.7"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "62948e14d923ea95ea2c7c86c71013138b66525b86bdc08d2dcc262bdb497b87"
-dependencies = [
- "memchr",
-]
-
 [[package]]
 name = "oid-registry"
 version = "0.7.1"
@@ -2968,9 +2920,9 @@ checksum = "42f5e15c9953c5e4ccceeb2e7382a716482c34515315f7b03532b8b4e8393d2d"
 
 [[package]]
 name = "once_cell_polyfill"
-version = "1.70.1"
+version = "1.70.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "a4895175b425cb1f87721b59f0f286c2092bd4af812243672510e1ac53e2e0ad"
+checksum = "384b8ab6d37215f3c5301a95a4accb5d64aa607f1fcb26a11b5303878451b4fe"
 
 [[package]]
 name = "opaque-debug"
@@ -2980,11 +2932,11 @@ checksum = "c08d65885ee38876c4f86fa503fb49d7b507c2b62552df7c70b2fce627e06381"
 
 [[package]]
 name = "openssl"
-version = "0.10.74"
+version = "0.10.75"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "24ad14dd45412269e1a30f52ad8f0664f0f4f4a89ee8fe28c3b3527021ebb654"
+checksum = "08838db121398ad17ab8531ce9de97b244589089e290a384c900cb9ff7434328"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "cfg-if",
  "foreign-types",
  "libc",
@@ -3001,7 +2953,7 @@ checksum = "a948666b637a0f465e8564c73e89d4dde00d72d4d473cc972f390fc3dcee7d9c"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -3012,9 +2964,9 @@ checksum = "d05e27ee213611ffe7d6348b942e8f942b37114c00cc03cec254295a4a17852e"
 
 [[package]]
 name = "openssl-sys"
-version = "0.9.110"
+version = "0.9.111"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0a9f0075ba3c21b09f8e8b2026584b1d18d49388648f2fbbf3c97ea8deced8e2"
+checksum = "82cab2d520aa75e3c58898289429321eb788c3106963d0dc886ec7a5f4adc321"
 dependencies = [
  "cc",
  "libc",
@@ -3032,16 +2984,9 @@ dependencies = [
  "hashbrown 0.12.3",
 ]
 
-[[package]]
-name = "overload"
-version = "0.1.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b15813163c1d831bf4a13c3610c05c0d03b39feb07f7e09fa234dac9b15aaf39"
-
 [[package]]
 name = "p2poolv2_api"
 version = "0.1.0"
-source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "axum",
  "base64 0.22.1",
@@ -3061,7 +3006,6 @@ dependencies = [
 [[package]]
 name = "p2poolv2_cli"
 version = "0.1.0"
-source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "base64 0.22.1",
  "clap",
@@ -3081,13 +3025,14 @@ dependencies = [
 [[package]]
 name = "p2poolv2_lib"
 version = "0.1.0"
-source = "git+https://github.com/keegreil/p2poolv2?branch=hydrapool-mod#a05417f7bf04e62b982bfba7ca0ebc6413ee0c76"
 dependencies = [
  "async-trait",
  "base64 0.22.1",
  "bitcoin",
  "bitcoindrpc",
  "chrono",
+ "ciborium",
+ "ciborium-io",
  "config",
  "dashmap",
  "futures",
@@ -3098,7 +3043,7 @@ dependencies = [
  "rust_decimal_macros",
  "serde",
  "serde_json",
- "thiserror 2.0.12",
+ "thiserror 2.0.17",
  "tokio",
  "tokio-stream",
  "tokio-util",
@@ -3118,9 +3063,9 @@ checksum = "f38d5652c16fde515bb1ecef450ab0f6a219d619a7274976324d5e377f7dceba"
 
 [[package]]
 name = "parking_lot"
-version = "0.12.4"
+version = "0.12.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13"
+checksum = "93857453250e3077bd71ff98b6a65ea6621a19bb0f559a85248955ac12c45a1a"
 dependencies = [
  "lock_api",
  "parking_lot_core",
@@ -3128,15 +3073,15 @@ dependencies = [
 
 [[package]]
 name = "parking_lot_core"
-version = "0.9.11"
+version = "0.9.12"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5"
+checksum = "2621685985a2ebf1c516881c026032ac7deafcda1a2c9b7850dc81e3dfcb64c1"
 dependencies = [
  "cfg-if",
  "libc",
  "redox_syscall",
  "smallvec",
- "windows-targets 0.52.6",
+ "windows-link",
 ]
 
 [[package]]
@@ -3153,36 +3098,35 @@ checksum = "df94ce210e5bc13cb6651479fa48d14f601d9858cfe0467f43ae157023b938d3"
 
 [[package]]
 name = "pem"
-version = "3.0.5"
+version = "3.0.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "38af38e8470ac9dee3ce1bae1af9c1671fffc44ddfd8bd1d0a3445bf349a8ef3"
+checksum = "1d30c53c26bc5b31a98cd02d20f25a7c8567146caf63ed593a9d87b2775291be"
 dependencies = [
  "base64 0.22.1",
- "serde",
+ "serde_core",
 ]
 
 [[package]]
 name = "percent-encoding"
-version = "2.3.1"
+version = "2.3.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e3148f5046208a5d56bcfc03053e3ca6334e51da8dfb19b6cdc8b306fae3283e"
+checksum = "9b4f627cb1b25917193a259e49bdad08f671f8d9708acfd5fe0a8c1455d87220"
 
 [[package]]
 name = "pest"
-version = "2.8.1"
+version = "2.8.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1db05f56d34358a8b1066f67cbb203ee3e7ed2ba674a6263a1d5ec6db2204323"
+checksum = "cbcfd20a6d4eeba40179f05735784ad32bdaef05ce8e8af05f180d45bb3e7e22"
 dependencies = [
  "memchr",
- "thiserror 2.0.12",
  "ucd-trie",
 ]
 
 [[package]]
 name = "pest_derive"
-version = "2.8.1"
+version = "2.8.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "bb056d9e8ea77922845ec74a1c4e8fb17e7c218cc4fc11a15c5d25e189aa40bc"
+checksum = "51f72981ade67b1ca6adc26ec221be9f463f2b5839c7508998daa17c23d94d7f"
 dependencies = [
  "pest",
  "pest_generator",
@@ -3190,22 +3134,22 @@ dependencies = [
 
 [[package]]
 name = "pest_generator"
-version = "2.8.1"
+version = "2.8.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "87e404e638f781eb3202dc82db6760c8ae8a1eeef7fb3fa8264b2ef280504966"
+checksum = "dee9efd8cdb50d719a80088b76f81aec7c41ed6d522ee750178f83883d271625"
 dependencies = [
  "pest",
  "pest_meta",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "pest_meta"
-version = "2.8.1"
+version = "2.8.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "edd1101f170f5903fde0914f899bb503d9ff5271d7ba76bbb70bea63690cc0d5"
+checksum = "bf1d70880e76bdc13ba52eafa6239ce793d85c8e43896507e43dd8984ff05b82"
 dependencies = [
  "pest",
  "sha2",
@@ -3228,7 +3172,7 @@ checksum = "6e918e4ff8c4549eb882f14b3a4bc8c8bc93de829416eacf579f1207a8fbf861"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -3261,16 +3205,16 @@ checksum = "7edddbd0b52d732b21ad9a5fab5c704c14cd949e5e9a1ec5929a24fded1b904c"
 
 [[package]]
 name = "polling"
-version = "3.9.0"
+version = "3.11.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8ee9b2fa7a4517d2c91ff5bc6c297a427a96749d15f98fcdbb22c05571a4d4b7"
+checksum = "5d0e4f59085d47d8241c88ead0f274e8a0cb551f3625263c05eb8dd897c34218"
 dependencies = [
  "cfg-if",
  "concurrent-queue",
  "hermit-abi",
  "pin-project-lite",
  "rustix",
- "windows-sys 0.60.2",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -3298,9 +3242,9 @@ dependencies = [
 
 [[package]]
 name = "potential_utf"
-version = "0.1.2"
+version = "0.1.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e5a7c30837279ca13e7c867e9e40053bc68740f988cb07f7ca6df43cc734b585"
+checksum = "b73949432f5e2a09657003c25bca5e19a0e9c84f8058ca374f49e0ebe605af77"
 dependencies = [
  "zerovec",
 ]
@@ -3322,18 +3266,18 @@ dependencies = [
 
 [[package]]
 name = "proc-macro-crate"
-version = "3.3.0"
+version = "3.4.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "edce586971a4dfaa28950c6f18ed55e0406c1ab88bbce2c6f6293a7aaba73d35"
+checksum = "219cb19e96be00ab2e37d6e299658a0cfa83e52429179969b0f0121b4ac46983"
 dependencies = [
- "toml_edit",
+ "toml_edit 0.23.9",
 ]
 
 [[package]]
 name = "proc-macro2"
-version = "1.0.95"
+version = "1.0.103"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "02b3e5e68a3a1a02aad3ec490a98007cbc13c37cbe84a3cd7b8e406d76e7f778"
+checksum = "5ee95bc4ef87b8d5ba32e8b7714ccc834865276eab0aed5c9958d00ec45f49e8"
 dependencies = [
  "unicode-ident",
 ]
@@ -3358,7 +3302,7 @@ checksum = "440f724eba9f6996b75d63681b0a92b06947f1457076d503a4d2e2c8f56442b8"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -3405,9 +3349,9 @@ dependencies = [
 
 [[package]]
 name = "quinn"
-version = "0.11.8"
+version = "0.11.9"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "626214629cda6781b6dc1d316ba307189c85ba657213ce642d9c77670f8202c8"
+checksum = "b9e20a958963c291dc322d98411f541009df2ced7b5a4f2bd52337638cfccf20"
 dependencies = [
  "bytes",
  "cfg_aliases",
@@ -3415,10 +3359,10 @@ dependencies = [
  "pin-project-lite",
  "quinn-proto",
  "quinn-udp",
- "rustc-hash 2.1.1",
+ "rustc-hash",
  "rustls",
- "socket2 0.5.10",
- "thiserror 2.0.12",
+ "socket2 0.6.1",
+ "thiserror 2.0.17",
  "tokio",
  "tracing",
  "web-time",
@@ -3426,20 +3370,20 @@ dependencies = [
 
 [[package]]
 name = "quinn-proto"
-version = "0.11.12"
+version = "0.11.13"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "49df843a9161c85bb8aae55f101bc0bac8bcafd637a620d9122fd7e0b2f7422e"
+checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31"
 dependencies = [
  "bytes",
- "getrandom 0.3.3",
+ "getrandom 0.3.4",
  "lru-slab",
  "rand 0.9.2",
  "ring 0.17.14",
- "rustc-hash 2.1.1",
+ "rustc-hash",
  "rustls",
  "rustls-pki-types",
  "slab",
- "thiserror 2.0.12",
+ "thiserror 2.0.17",
  "tinyvec",
  "tracing",
  "web-time",
@@ -3447,23 +3391,23 @@ dependencies = [
 
 [[package]]
 name = "quinn-udp"
-version = "0.5.13"
+version = "0.5.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "fcebb1209ee276352ef14ff8732e24cc2b02bbac986cd74a4c81bcb2f9881970"
+checksum = "addec6a0dcad8a8d96a771f815f0eaf55f9d1805756410b39f5fa81332574cbd"
 dependencies = [
  "cfg_aliases",
  "libc",
  "once_cell",
- "socket2 0.5.10",
+ "socket2 0.6.1",
  "tracing",
- "windows-sys 0.59.0",
+ "windows-sys 0.60.2",
 ]
 
 [[package]]
 name = "quote"
-version = "1.0.40"
+version = "1.0.42"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1885c039570dc00dcb4ff087a89e185fd56bae234ddc7f056a945bf36467248d"
+checksum = "a338cc41d27e6cc6dce6cefc13a0729dfbb81c262b1f519331575dd80ef3067f"
 dependencies = [
  "proc-macro2",
 ]
@@ -3536,14 +3480,14 @@ version = "0.9.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "99d9a13982dcf210057a8a78572b2217b667c3beacbf3a0d8b454f6f82837d38"
 dependencies = [
- "getrandom 0.3.3",
+ "getrandom 0.3.4",
 ]
 
 [[package]]
 name = "rayon"
-version = "1.10.0"
+version = "1.11.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b418a60154510ca1a002a752ca9714984e21e4241e804d32555251faf8b78ffa"
+checksum = "368f01d005bf8fd9b1206fb6fa653e6c4a81ceb1466406b81792d87c5677a58f"
 dependencies = [
  "either",
  "rayon-core",
@@ -3551,9 +3495,9 @@ dependencies = [
 
 [[package]]
 name = "rayon-core"
-version = "1.12.1"
+version = "1.13.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1465873a3dfdaa8ae7cb14b4383657caab0b3e8a0aa9ae8e04b044854c8dfce2"
+checksum = "22e18b0f0062d30d4230b2e85ff77fdfe4326feb054b9783a3460d8435c8ab91"
 dependencies = [
  "crossbeam-deque",
  "crossbeam-utils",
@@ -3573,56 +3517,41 @@ dependencies = [
 
 [[package]]
 name = "redox_syscall"
-version = "0.5.15"
+version = "0.5.18"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "7e8af0dde094006011e6a740d4879319439489813bd0bcdc7d821beaeeff48ec"
+checksum = "ed2bf2547551a7053d6fdfafda3f938979645c44812fbfcda098faae3f1a362d"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
 ]
 
 [[package]]
 name = "regex"
-version = "1.11.1"
+version = "1.12.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b544ef1b4eac5dc2db33ea63606ae9ffcfac26c1416a2806ae0bf5f56b201191"
+checksum = "843bc0191f75f3e22651ae5f1e72939ab2f72a4bc30fa80a066bd66edefc24d4"
 dependencies = [
  "aho-corasick",
  "memchr",
- "regex-automata 0.4.9",
- "regex-syntax 0.8.5",
+ "regex-automata",
+ "regex-syntax",
 ]
 
 [[package]]
 name = "regex-automata"
-version = "0.1.10"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6c230d73fb8d8c1b9c0b3135c5142a8acee3a0558fb8db5cf1cb65f8d7862132"
-dependencies = [
- "regex-syntax 0.6.29",
-]
-
-[[package]]
-name = "regex-automata"
-version = "0.4.9"
+version = "0.4.13"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "809e8dc61f6de73b46c85f4c96486310fe304c434cfa43669d7b40f711150908"
+checksum = "5276caf25ac86c8d810222b3dbb938e512c55c6831a10f3e6ed1c93b84041f1c"
 dependencies = [
  "aho-corasick",
  "memchr",
- "regex-syntax 0.8.5",
+ "regex-syntax",
 ]
 
 [[package]]
 name = "regex-syntax"
-version = "0.6.29"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f162c6dd7b008981e4d40210aca20b4bd0f9b60ca9271061b07f78537722f2e1"
-
-[[package]]
-name = "regex-syntax"
-version = "0.8.5"
+version = "0.8.8"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2b15c43186be67a4fd63bee50d0303afffcef381492ebe2c5d87f324e1b8815c"
+checksum = "7a2d987857b319362043e95f5353c0535c1f58eec5336fdfcf626430af7def58"
 
 [[package]]
 name = "rend"
@@ -3675,19 +3604,19 @@ dependencies = [
 
 [[package]]
 name = "reqwest"
-version = "0.12.24"
+version = "0.12.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9d0946410b9f7b082a427e4ef5c8ff541a88b357bc6c637c40db3a68ac70a36f"
+checksum = "b6eff9328d40131d43bd911d42d79eb6a47312002a4daefc9e37f17e74a7701a"
 dependencies = [
  "base64 0.22.1",
  "bytes",
  "encoding_rs",
  "futures-core",
- "h2 0.4.11",
- "http 1.3.1",
+ "h2 0.4.12",
+ "http 1.4.0",
  "http-body 1.0.1",
  "http-body-util",
- "hyper 1.6.0",
+ "hyper 1.8.1",
  "hyper-rustls",
  "hyper-tls 0.6.0",
  "hyper-util",
@@ -3715,9 +3644,9 @@ dependencies = [
 
 [[package]]
 name = "resolv-conf"
-version = "0.7.4"
+version = "0.7.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "95325155c684b1c89f7765e30bc1c42e4a6da51ca513615660cb8a62ef9a88e3"
+checksum = "1e061d1b48cb8d38042de4ae0a7a6401009d6143dc80d2e2d6f31f0bdd6470c7"
 
 [[package]]
 name = "rfc6979"
@@ -3859,9 +3788,9 @@ dependencies = [
 
 [[package]]
 name = "rust_decimal"
-version = "1.37.2"
+version = "1.39.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b203a6425500a03e0919c42d3c47caca51e79f1132046626d2c8871c5092035d"
+checksum = "35affe401787a9bd846712274d97654355d21b2a2c092a3139aabe31e9022282"
 dependencies = [
  "arrayvec",
  "borsh",
@@ -3875,26 +3804,14 @@ dependencies = [
 
 [[package]]
 name = "rust_decimal_macros"
-version = "1.37.1"
+version = "1.39.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f6268b74858287e1a062271b988a0c534bf85bbeb567fe09331bf40ed78113d5"
+checksum = "ae8c0cb48f413ebe24dc2d148788e0efbe09ba3e011d9277162f2eaf8e1069a3"
 dependencies = [
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
-[[package]]
-name = "rustc-demangle"
-version = "0.1.25"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "989e6739f80c4ad5b13e0fd7fe89531180375b18520cc8c82080e4dc4035b84f"
-
-[[package]]
-name = "rustc-hash"
-version = "1.1.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "08d43f7aa6b08d49f382cde6a7982047c3426db949b1424bc4b7ec9ae12c6ce2"
-
 [[package]]
 name = "rustc-hash"
 version = "2.1.1"
@@ -3921,27 +3838,27 @@ dependencies = [
 
 [[package]]
 name = "rustix"
-version = "1.0.8"
+version = "1.1.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "11181fbabf243db407ef8df94a6ce0b2f9a733bd8be4ad02b4eda9602296cac8"
+checksum = "cd15f8a2c5551a84d56efdc1cd049089e409ac19a3072d5037a17fd70719ff3e"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "errno",
  "libc",
  "linux-raw-sys",
- "windows-sys 0.60.2",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
 name = "rustls"
-version = "0.23.29"
+version = "0.23.35"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2491382039b29b9b11ff08b76ff6c97cf287671dbb74f0be44bda389fffe9bd1"
+checksum = "533f54bc6a7d4f647e46ad909549eda97bf5afc1585190ef692b4286b198bd8f"
 dependencies = [
  "once_cell",
  "ring 0.17.14",
  "rustls-pki-types",
- "rustls-webpki 0.103.4",
+ "rustls-webpki 0.103.8",
  "subtle",
  "zeroize",
 ]
@@ -3957,9 +3874,9 @@ dependencies = [
 
 [[package]]
 name = "rustls-pki-types"
-version = "1.12.0"
+version = "1.13.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79"
+checksum = "708c0f9d5f54ba0272468c1d306a52c495b31fa155e91bc25371e6df7996908c"
 dependencies = [
  "web-time",
  "zeroize",
@@ -3977,9 +3894,9 @@ dependencies = [
 
 [[package]]
 name = "rustls-webpki"
-version = "0.103.4"
+version = "0.103.8"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0a17884ae0c1b773f1ccd2bd4a8c72f16da897310a98b0e84bf349ad5ead92fc"
+checksum = "2ffdfa2f5286e2247234e03f680868ac2815974dc39e00ea15adc445d0aafe52"
 dependencies = [
  "ring 0.17.14",
  "rustls-pki-types",
@@ -3988,9 +3905,9 @@ dependencies = [
 
 [[package]]
 name = "rustversion"
-version = "1.0.21"
+version = "1.0.22"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8a0d197bd2c9dc6e53b84da9556a69ba4cdfab8619eb41a8bd1cc2027a0f6b1d"
+checksum = "b39cdef0fa800fc44525c84ccb54a029961a8215f9619753635a9c0d2538d46d"
 
 [[package]]
 name = "rw-stream-sink"
@@ -4020,11 +3937,11 @@ dependencies = [
 
 [[package]]
 name = "schannel"
-version = "0.1.27"
+version = "0.1.28"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1f29ebaa345f945cec9fbbc532eb307f0fdad8161f281b6369539c8d84876b3d"
+checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1"
 dependencies = [
- "windows-sys 0.59.0",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -4080,7 +3997,7 @@ version = "2.11.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "897b2245f0b511c87893af39b033e5ca9cce68824c4d7e7630b5a1d339658d02"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "core-foundation",
  "core-foundation-sys",
  "libc",
@@ -4089,9 +4006,9 @@ dependencies = [
 
 [[package]]
 name = "security-framework-sys"
-version = "2.14.0"
+version = "2.15.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "49db231d56a190491cb4aeda9527f1ad45345af50b0851622a7adb8c03b01c32"
+checksum = "cc1f0cbffaac4852523ce30d8bd3c5cdc873501d96ff467ca09b6767bb8cd5c0"
 dependencies = [
  "core-foundation-sys",
  "libc",
@@ -4099,9 +4016,9 @@ dependencies = [
 
 [[package]]
 name = "semver"
-version = "1.0.26"
+version = "1.0.27"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "56e6fa9c48d24d85fb3de5ad847117517440f6beceb7798af16b4a87d616b8d0"
+checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2"
 
 [[package]]
 name = "serde"
@@ -4130,19 +4047,20 @@ checksum = "d540f220d3187173da220f885ab66608367b6574e925011a9353e4badda91d79"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "serde_json"
-version = "1.0.141"
+version = "1.0.145"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "30b9eff21ebe718216c6ec64e1d9ac57087aad11efc64e32002bce4a0d4c03d3"
+checksum = "402a6f66d8c709116cf22f558eab210f5a50187f702eb4d7e5ef38d9a7f1c79c"
 dependencies = [
  "itoa",
  "memchr",
  "ryu",
  "serde",
+ "serde_core",
 ]
 
 [[package]]
@@ -4205,9 +4123,9 @@ checksum = "0fda2ff0d084019ba4d7c6f371c95d8fd75ce3524c3cb8fb653a3023f6323e64"
 
 [[package]]
 name = "signal-hook-registry"
-version = "1.4.5"
+version = "1.4.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9203b8055f63a2a00e2f593bb0510367fe707d7ff1e5c872de2f537b339e5410"
+checksum = "7664a098b8e616bdfcc2dc0e9ac44eb231eedf41db4e9fe95d8d32ec728dedad"
 dependencies = [
  "libc",
 ]
@@ -4230,9 +4148,9 @@ checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e"
 
 [[package]]
 name = "slab"
-version = "0.4.10"
+version = "0.4.11"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "04dc19736151f35336d325007ac991178d504a119863a2fcb3758cdb5e52c50d"
+checksum = "7a2ae44ef20feb57a68b23d846850f861394c2e02dc425a50098ae8c90267589"
 
 [[package]]
 name = "smallvec"
@@ -4269,12 +4187,12 @@ dependencies = [
 
 [[package]]
 name = "socket2"
-version = "0.6.0"
+version = "0.6.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807"
+checksum = "17129e116933cf371d018bb80ae557e889637989d8638274fb25622827b03881"
 dependencies = [
  "libc",
- "windows-sys 0.59.0",
+ "windows-sys 0.60.2",
 ]
 
 [[package]]
@@ -4295,9 +4213,9 @@ dependencies = [
 
 [[package]]
 name = "stable_deref_trait"
-version = "1.2.0"
+version = "1.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3"
+checksum = "6ce2be8dc25455e1f91df71bfa12ad37d7af1092ae736f3a6cd0e37bc7810596"
 
 [[package]]
 name = "static_assertions"
@@ -4330,9 +4248,9 @@ dependencies = [
 
 [[package]]
 name = "syn"
-version = "2.0.104"
+version = "2.0.111"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "17b6f705963418cdb9927482fa304bc562ece2fdd4f616084c50b7023b435a40"
+checksum = "390cc9a294ab71bdb1aa2e99d13be9c753cd2d7bd6560c77118597410c4d2e87"
 dependencies = [
  "proc-macro2",
  "quote",
@@ -4362,7 +4280,7 @@ checksum = "728a70f3dbaf5bab7f0c4b1ac8d7ae5ea60a4b5549c8a5914361c99147a709d2"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -4382,7 +4300,7 @@ version = "0.6.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "3c879d448e9d986b661742763247d3693ed13609438cf3d006f51f5368a5ba6b"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "core-foundation",
  "system-configuration-sys 0.6.0",
 ]
@@ -4439,10 +4357,10 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16"
 dependencies = [
  "fastrand",
- "getrandom 0.3.3",
+ "getrandom 0.3.4",
  "once_cell",
  "rustix",
- "windows-sys 0.60.2",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -4456,11 +4374,11 @@ dependencies = [
 
 [[package]]
 name = "thiserror"
-version = "2.0.12"
+version = "2.0.17"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "567b8a2dae586314f7be2a752ec7474332959c6460e02bde30d702a66d488708"
+checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8"
 dependencies = [
- "thiserror-impl 2.0.12",
+ "thiserror-impl 2.0.17",
 ]
 
 [[package]]
@@ -4471,18 +4389,18 @@ checksum = "4fee6c4efc90059e10f81e6d42c60a18f76588c3d74cb83a0b242a2b6c7504c1"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "thiserror-impl"
-version = "2.0.12"
+version = "2.0.17"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "7f7cf42b4507d8ea322120659672cf1b9dbb93f8f2d4ecfd6e51350ff5b17a1d"
+checksum = "3ff15c8ecd7de3849db632e14d18d2571fa09dfc5ed93479bc4485c7a517c913"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -4496,9 +4414,9 @@ dependencies = [
 
 [[package]]
 name = "time"
-version = "0.3.41"
+version = "0.3.44"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8a7619e19bc266e0f9c5e6686659d394bc57973859340060a69221e57dbc0c40"
+checksum = "91e7d9e3bb61134e77bde20dd4825b97c010155709965fedf0f49bb138e52a9d"
 dependencies = [
  "deranged",
  "itoa",
@@ -4511,15 +4429,15 @@ dependencies = [
 
 [[package]]
 name = "time-core"
-version = "0.1.4"
+version = "0.1.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c9e9a38711f559d9e3ce1cdb06dd7c5b8ea546bc90052da6d06bb76da74bb07c"
+checksum = "40868e7c1d2f0b8d73e4a8c7f0ff63af4f6d19be117e90bd73eb1d62cf831c6b"
 
 [[package]]
 name = "time-macros"
-version = "0.2.22"
+version = "0.2.24"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3526739392ec93fd8b359c8e98514cb3e8e021beb4e5f597b00a0221f8ed8a49"
+checksum = "30cfb0125f12d9c277f35663a0a33f8c30190f4e4574868a330595412d34ebf3"
 dependencies = [
  "num-conv",
  "time-core",
@@ -4527,9 +4445,9 @@ dependencies = [
 
 [[package]]
 name = "tinystr"
-version = "0.8.1"
+version = "0.8.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5d4f6d1145dcb577acf783d4e601bc1d76a13337bb54e6233add580b07344c8b"
+checksum = "42d3e9c45c09de15d06dd8acf5f4e0e399e85927b7f00711024eb7ae10fa4869"
 dependencies = [
  "displaydoc",
  "zerovec",
@@ -4537,9 +4455,9 @@ dependencies = [
 
 [[package]]
 name = "tinyvec"
-version = "1.9.0"
+version = "1.10.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "09b3661f17e86524eccd4371ab0429194e0d7c008abb45f7a7495b1719463c71"
+checksum = "bfa5fdc3bce6191a1dbc8c02d5c8bffcf557bafa17c124c5264a458f1b0613fa"
 dependencies = [
  "tinyvec_macros",
 ]
@@ -4552,33 +4470,30 @@ checksum = "1f3ccbac311fea05f86f61904b462b55fb3df8837a366dfc601a0161d0532f20"
 
 [[package]]
 name = "tokio"
-version = "1.46.1"
+version = "1.48.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0cc3a2344dafbe23a245241fe8b09735b521110d30fcefbbd5feb1797ca35d17"
+checksum = "ff360e02eab121e0bc37a2d3b4d4dc622e6eda3a8e5253d5435ecf5bd4c68408"
 dependencies = [
- "backtrace",
  "bytes",
- "io-uring",
  "libc",
  "mio",
  "parking_lot",
  "pin-project-lite",
  "signal-hook-registry",
- "slab",
- "socket2 0.5.10",
+ "socket2 0.6.1",
  "tokio-macros",
- "windows-sys 0.52.0",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
 name = "tokio-macros"
-version = "2.5.0"
+version = "2.6.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8"
+checksum = "af407857209536a95c8e56f8231ef2c2e2aff839b22e07a1ffcbc617e9db9fa5"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -4593,9 +4508,9 @@ dependencies = [
 
 [[package]]
 name = "tokio-rustls"
-version = "0.26.2"
+version = "0.26.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8e727b36a1a0e8b74c376ac2211e40c2c8af09fb4013c60d910495810f008e9b"
+checksum = "1729aa945f29d91ba541258c8df89027d5792d85a8841fb65e8bf0f4ede4ef61"
 dependencies = [
  "rustls",
  "tokio",
@@ -4614,9 +4529,9 @@ dependencies = [
 
 [[package]]
 name = "tokio-util"
-version = "0.7.15"
+version = "0.7.17"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "66a539a9ad6d5d281510d5bd368c973d636c02dbf8a67300bfb6b950696ad7df"
+checksum = "2efa149fe76073d6e8fd97ef4f4eca7b67f599660115591483572e406e165594"
 dependencies = [
  "bytes",
  "futures-core",
@@ -4642,8 +4557,8 @@ checksum = "dc1beb996b9d83529a9e75c17a1686767d148d70663143c7854d8b4a09ced362"
 dependencies = [
  "serde",
  "serde_spanned",
- "toml_datetime",
- "toml_edit",
+ "toml_datetime 0.6.11",
+ "toml_edit 0.22.27",
 ]
 
 [[package]]
@@ -4655,6 +4570,15 @@ dependencies = [
  "serde",
 ]
 
+[[package]]
+name = "toml_datetime"
+version = "0.7.3"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f2cdb639ebbc97961c51720f858597f7f24c4fc295327923af55b74c3c724533"
+dependencies = [
+ "serde_core",
+]
+
 [[package]]
 name = "toml_edit"
 version = "0.22.27"
@@ -4664,7 +4588,28 @@ dependencies = [
  "indexmap",
  "serde",
  "serde_spanned",
- "toml_datetime",
+ "toml_datetime 0.6.11",
+ "winnow",
+]
+
+[[package]]
+name = "toml_edit"
+version = "0.23.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "5d7cbc3b4b49633d57a0509303158ca50de80ae32c265093b24c414705807832"
+dependencies = [
+ "indexmap",
+ "toml_datetime 0.7.3",
+ "toml_parser",
+ "winnow",
+]
+
+[[package]]
+name = "toml_parser"
+version = "1.0.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c0cbe268d35bdb4bb5a56a2de88d0ad0eb70af5384a99d648cd4b3d04039800e"
+dependencies = [
  "winnow",
 ]
 
@@ -4687,14 +4632,14 @@ dependencies = [
 
 [[package]]
 name = "tower-http"
-version = "0.6.6"
+version = "0.6.8"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "adc82fd73de2a9722ac5da747f12383d2bfdb93591ee6c58486e0097890f05f2"
+checksum = "d4e6559d53cc268e5031cd8429d05415bc4cb4aefc4aa5d6cc35fbf5b924a1f8"
 dependencies = [
- "bitflags 2.9.1",
+ "bitflags 2.10.0",
  "bytes",
  "futures-util",
- "http 1.3.1",
+ "http 1.4.0",
  "http-body 1.0.1",
  "iri-string",
  "pin-project-lite",
@@ -4717,9 +4662,9 @@ checksum = "8df9b6e13f2d32c91b9bd719c00d1958837bc7dec474d94952798cc8e69eeec3"
 
 [[package]]
 name = "tracing"
-version = "0.1.41"
+version = "0.1.43"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "784e0ac535deb450455cbfa28a6f0df145ea1bb7ae51b821cf5e7927fdcfbdd0"
+checksum = "2d15d90a0b5c19378952d479dc858407149d7bb45a14de0142f6c534b16fc647"
 dependencies = [
  "log",
  "pin-project-lite",
@@ -4729,32 +4674,32 @@ dependencies = [
 
 [[package]]
 name = "tracing-appender"
-version = "0.2.3"
+version = "0.2.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3566e8ce28cc0a3fe42519fc80e6b4c943cc4c8cef275620eb8dac2d3d4e06cf"
+checksum = "786d480bce6247ab75f005b14ae1624ad978d3029d9113f0a22fa1ac773faeaf"
 dependencies = [
  "crossbeam-channel",
- "thiserror 1.0.69",
+ "thiserror 2.0.17",
  "time",
  "tracing-subscriber",
 ]
 
 [[package]]
 name = "tracing-attributes"
-version = "0.1.30"
+version = "0.1.31"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "81383ab64e72a7a8b8e13130c49e3dab29def6d0c7d76a03087b3cf71c5c6903"
+checksum = "7490cfa5ec963746568740651ac6781f701c9c5ea257c58e057f3ba8cf69e8da"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
 name = "tracing-core"
-version = "0.1.34"
+version = "0.1.35"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "b9d12581f227e93f094d3af2ae690a574abb8a2b9b7a96e7cfe9647b2b617678"
+checksum = "7a04e24fab5c89c6a36eb8558c9656f30d81de51dfa4d3b45f26b21d61fa0a6c"
 dependencies = [
  "once_cell",
  "valuable",
@@ -4773,14 +4718,14 @@ dependencies = [
 
 [[package]]
 name = "tracing-subscriber"
-version = "0.3.19"
+version = "0.3.22"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e8189decb5ac0fa7bc8b96b7cb9b2701d60d48805aca84a238004d665fcc4008"
+checksum = "2f30143827ddab0d256fd843b7a66d164e9f271cfa0dde49142c5ca0ca291f1e"
 dependencies = [
  "matchers",
  "nu-ansi-term",
  "once_cell",
- "regex",
+ "regex-automata",
  "sharded-slab",
  "smallvec",
  "thread_local",
@@ -4797,9 +4742,9 @@ checksum = "e421abadd41a4225275504ea4d6566923418b7f05506fbc9c0fe86ba7396114b"
 
 [[package]]
 name = "typenum"
-version = "1.18.0"
+version = "1.19.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1dccffe3ce07af9386bfd29e80c0ab1a8205a2fc34e4bcd40364df902cfa8f3f"
+checksum = "562d481066bde0658276a35467c4af00bdc6ee726305698a55b86e61d7ad82bb"
 
 [[package]]
 name = "ucd-trie"
@@ -4821,9 +4766,9 @@ dependencies = [
 
 [[package]]
 name = "unicode-ident"
-version = "1.0.18"
+version = "1.0.22"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5a5f39404a5da50712a4c1eecf25e90dd62b613502b7e925fd4e4d19b5c96512"
+checksum = "9312f7c4f6ff9069b165498234ce8be658059c6728633667c526e27dc2cf1df5"
 
 [[package]]
 name = "universal-hash"
@@ -4861,13 +4806,14 @@ checksum = "8ecb6da28b8a351d773b68d5825ac39017e680750f980f3a1a85cd8dd28a47c1"
 
 [[package]]
 name = "url"
-version = "2.5.4"
+version = "2.5.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "32f8b686cadd1473f4bd0117a5d28d36b1ade384ea9b5069a1c40aefed7fda60"
+checksum = "08bc136a29a3d1758e07a9cca267be308aeebf5cfd5a10f3f67ab2097683ef5b"
 dependencies = [
  "form_urlencoded",
  "idna",
  "percent-encoding",
+ "serde",
 ]
 
 [[package]]
@@ -4884,9 +4830,9 @@ checksum = "06abde3611657adf66d383f00b093d7faecc7fa57071cce2578660c9f1010821"
 
 [[package]]
 name = "uuid"
-version = "1.17.0"
+version = "1.19.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3cf4199d1e5d15ddd86a694e4d0dffa9c323ce759fea589f00fef9d81cc1931d"
+checksum = "e2e054861b4bd027cd373e18e8d8d8e6548085000e41290d95ce0c373a654b4a"
 dependencies = [
  "js-sys",
  "wasm-bindgen",
@@ -4906,9 +4852,9 @@ checksum = "accd4ea62f7bb7a82fe23066fb0957d48ef677f6eeb8215f372f52e48bb32426"
 
 [[package]]
 name = "version-compare"
-version = "0.2.0"
+version = "0.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "852e951cb7832cb45cb1169900d19760cfa39b82bc0ea9c0e5a14ae88411c98b"
+checksum = "03c2856837ef78f57382f06b2b8563a2f512f7185d732608fd9176cb3b8edf0e"
 
 [[package]]
 name = "version_check"
@@ -4948,45 +4894,32 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "ccf3ec651a847eb01de73ccad15eb7d99f80485de043efb2f370cd654f4ea44b"
 
 [[package]]
-name = "wasi"
-version = "0.14.2+wasi-0.2.4"
+name = "wasip2"
+version = "1.0.1+wasi-0.2.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9683f9a5a998d873c0d21fcbe3c083009670149a8fab228644b8bd36b2c48cb3"
+checksum = "0562428422c63773dad2c345a1882263bbf4d65cf3f42e90921f787ef5ad58e7"
 dependencies = [
- "wit-bindgen-rt",
+ "wit-bindgen",
 ]
 
 [[package]]
 name = "wasm-bindgen"
-version = "0.2.100"
+version = "0.2.106"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1edc8929d7499fc4e8f0be2262a241556cfc54a0bea223790e71446f2aab1ef5"
+checksum = "0d759f433fa64a2d763d1340820e46e111a7a5ab75f993d1852d70b03dbb80fd"
 dependencies = [
  "cfg-if",
  "once_cell",
  "rustversion",
  "wasm-bindgen-macro",
-]
-
-[[package]]
-name = "wasm-bindgen-backend"
-version = "0.2.100"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2f0a0651a5c2bc21487bde11ee802ccaf4c51935d0d3d42a6101f98161700bc6"
-dependencies = [
- "bumpalo",
- "log",
- "proc-macro2",
- "quote",
- "syn 2.0.104",
  "wasm-bindgen-shared",
 ]
 
 [[package]]
 name = "wasm-bindgen-futures"
-version = "0.4.50"
+version = "0.4.56"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "555d470ec0bc3bb57890405e5d4322cc9ea83cebb085523ced7be4144dac1e61"
+checksum = "836d9622d604feee9e5de25ac10e3ea5f2d65b41eac0d9ce72eb5deae707ce7c"
 dependencies = [
  "cfg-if",
  "js-sys",
@@ -4997,9 +4930,9 @@ dependencies = [
 
 [[package]]
 name = "wasm-bindgen-macro"
-version = "0.2.100"
+version = "0.2.106"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "7fe63fc6d09ed3792bd0897b314f53de8e16568c2b3f7982f468c0bf9bd0b407"
+checksum = "48cb0d2638f8baedbc542ed444afc0644a29166f1595371af4fecf8ce1e7eeb3"
 dependencies = [
  "quote",
  "wasm-bindgen-macro-support",
@@ -5007,31 +4940,31 @@ dependencies = [
 
 [[package]]
 name = "wasm-bindgen-macro-support"
-version = "0.2.100"
+version = "0.2.106"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8ae87ea40c9f689fc23f209965b6fb8a99ad69aeeb0231408be24920604395de"
+checksum = "cefb59d5cd5f92d9dcf80e4683949f15ca4b511f4ac0a6e14d4e1ac60c6ecd40"
 dependencies = [
+ "bumpalo",
  "proc-macro2",
  "quote",
- "syn 2.0.104",
- "wasm-bindgen-backend",
+ "syn 2.0.111",
  "wasm-bindgen-shared",
 ]
 
 [[package]]
 name = "wasm-bindgen-shared"
-version = "0.2.100"
+version = "0.2.106"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1a05d73b933a847d6cccdda8f838a22ff101ad9bf93e33684f39c1f5f0eece3d"
+checksum = "cbc538057e648b67f72a982e708d485b2efa771e1ac05fec311f9f63e5800db4"
 dependencies = [
  "unicode-ident",
 ]
 
 [[package]]
 name = "web-sys"
-version = "0.3.77"
+version = "0.3.83"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "33b6dd2ef9186f1f2072e409e99cd22a975331a6b3591b12c764e0e55c60d5d2"
+checksum = "9b32828d774c412041098d182a8b38b16ea816958e07cf40eec2bc080ae137ac"
 dependencies = [
  "js-sys",
  "wasm-bindgen",
@@ -5049,9 +4982,9 @@ dependencies = [
 
 [[package]]
 name = "widestring"
-version = "1.2.0"
+version = "1.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "dd7cf3379ca1aac9eea11fba24fd7e315d621f8dfe35c8d7d2be8b793726e07d"
+checksum = "72069c3113ab32ab29e5584db3c6ec55d416895e60715417b5b883a357c3e471"
 
 [[package]]
 name = "winapi"
@@ -5071,11 +5004,11 @@ checksum = "ac3b87c63620426dd9b991e5ce0329eff545bccbbb34f3be09ff6fb6ab51b7b6"
 
 [[package]]
 name = "winapi-util"
-version = "0.1.9"
+version = "0.1.11"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "cf221c93e13a30d793f7645a0e7762c55d169dbb0a49671918a2319d289b10bb"
+checksum = "c2a7b1c03c876122aa43f3020e6c3c3ee5c05081c9a00739faf7503aeba10d22"
 dependencies = [
- "windows-sys 0.59.0",
+ "windows-sys 0.61.2",
 ]
 
 [[package]]
@@ -5112,9 +5045,9 @@ checksum = "b8e83a14d34d0623b51dce9581199302a221863196a1dde71a7663a4c2be9deb"
 dependencies = [
  "windows-implement",
  "windows-interface",
- "windows-link 0.2.1",
+ "windows-link",
  "windows-result 0.4.1",
- "windows-strings 0.5.1",
+ "windows-strings",
 ]
 
 [[package]]
@@ -5125,7 +5058,7 @@ checksum = "053e2e040ab57b9dc951b72c264860db7eb3b0200ba345b4e4c3b14f67855ddf"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -5136,15 +5069,9 @@ checksum = "3f316c4a2570ba26bbec722032c4099d8c8bc095efccdc15688708623367e358"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
-[[package]]
-name = "windows-link"
-version = "0.1.3"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5e6ad25900d524eaabdbbb96d20b4311e1e7ae1699af4fb28c17ae66c80d798a"
-
 [[package]]
 name = "windows-link"
 version = "0.2.1"
@@ -5153,13 +5080,13 @@ checksum = "f0805222e57f7521d6a62e36fa9163bc891acd422f971defe97d64e70d0a4fe5"
 
 [[package]]
 name = "windows-registry"
-version = "0.5.3"
+version = "0.6.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5b8a9ed28765efc97bbc954883f4e6796c33a06546ebafacbabee9696967499e"
+checksum = "02752bf7fbdcce7f2a27a742f798510f3e5ad88dbe84871e5168e2120c3d5720"
 dependencies = [
- "windows-link 0.1.3",
- "windows-result 0.3.4",
- "windows-strings 0.4.2",
+ "windows-link",
+ "windows-result 0.4.1",
+ "windows-strings",
 ]
 
 [[package]]
@@ -5171,31 +5098,13 @@ dependencies = [
  "windows-targets 0.52.6",
 ]
 
-[[package]]
-name = "windows-result"
-version = "0.3.4"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "56f42bd332cc6c8eac5af113fc0c1fd6a8fd2aa08a0119358686e5160d0586c6"
-dependencies = [
- "windows-link 0.1.3",
-]
-
 [[package]]
 name = "windows-result"
 version = "0.4.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "7781fa89eaf60850ac3d2da7af8e5242a5ea78d1a11c49bf2910bb5a73853eb5"
 dependencies = [
- "windows-link 0.2.1",
-]
-
-[[package]]
-name = "windows-strings"
-version = "0.4.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "56e6c93f3a0c3b36176cb1327a4958a0353d5d166c2a35cb268ace15e91d3b57"
-dependencies = [
- "windows-link 0.1.3",
+ "windows-link",
 ]
 
 [[package]]
@@ -5204,7 +5113,7 @@ version = "0.5.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "7837d08f69c77cf6b07689544538e017c1bfcf57e34b4c0ff58e6c2cd3b37091"
 dependencies = [
- "windows-link 0.2.1",
+ "windows-link",
 ]
 
 [[package]]
@@ -5240,7 +5149,16 @@ version = "0.60.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb"
 dependencies = [
- "windows-targets 0.53.2",
+ "windows-targets 0.53.5",
+]
+
+[[package]]
+name = "windows-sys"
+version = "0.61.2"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "ae137229bcbd6cdf0f7b80a31df61766145077ddf49416a728b02cb3921ff3fc"
+dependencies = [
+ "windows-link",
 ]
 
 [[package]]
@@ -5276,18 +5194,19 @@ dependencies = [
 
 [[package]]
 name = "windows-targets"
-version = "0.53.2"
+version = "0.53.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c66f69fcc9ce11da9966ddb31a40968cad001c5bedeb5c2b82ede4253ab48aef"
+checksum = "4945f9f551b88e0d65f3db0bc25c33b8acea4d9e41163edf90dcd0b19f9069f3"
 dependencies = [
- "windows_aarch64_gnullvm 0.53.0",
- "windows_aarch64_msvc 0.53.0",
- "windows_i686_gnu 0.53.0",
- "windows_i686_gnullvm 0.53.0",
- "windows_i686_msvc 0.53.0",
- "windows_x86_64_gnu 0.53.0",
- "windows_x86_64_gnullvm 0.53.0",
- "windows_x86_64_msvc 0.53.0",
+ "windows-link",
+ "windows_aarch64_gnullvm 0.53.1",
+ "windows_aarch64_msvc 0.53.1",
+ "windows_i686_gnu 0.53.1",
+ "windows_i686_gnullvm 0.53.1",
+ "windows_i686_msvc 0.53.1",
+ "windows_x86_64_gnu 0.53.1",
+ "windows_x86_64_gnullvm 0.53.1",
+ "windows_x86_64_msvc 0.53.1",
 ]
 
 [[package]]
@@ -5304,9 +5223,9 @@ checksum = "32a4622180e7a0ec044bb555404c800bc9fd9ec262ec147edd5989ccd0c02cd3"
 
 [[package]]
 name = "windows_aarch64_gnullvm"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "86b8d5f90ddd19cb4a147a5fa63ca848db3df085e25fee3cc10b39b6eebae764"
+checksum = "a9d8416fa8b42f5c947f8482c43e7d89e73a173cead56d044f6a56104a6d1b53"
 
 [[package]]
 name = "windows_aarch64_msvc"
@@ -5322,9 +5241,9 @@ checksum = "09ec2a7bb152e2252b53fa7803150007879548bc709c039df7627cabbd05d469"
 
 [[package]]
 name = "windows_aarch64_msvc"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c7651a1f62a11b8cbd5e0d42526e55f2c99886c77e007179efff86c2b137e66c"
+checksum = "b9d782e804c2f632e395708e99a94275910eb9100b2114651e04744e9b125006"
 
 [[package]]
 name = "windows_i686_gnu"
@@ -5340,9 +5259,9 @@ checksum = "8e9b5ad5ab802e97eb8e295ac6720e509ee4c243f69d781394014ebfe8bbfa0b"
 
 [[package]]
 name = "windows_i686_gnu"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c1dc67659d35f387f5f6c479dc4e28f1d4bb90ddd1a5d3da2e5d97b42d6272c3"
+checksum = "960e6da069d81e09becb0ca57a65220ddff016ff2d6af6a223cf372a506593a3"
 
 [[package]]
 name = "windows_i686_gnullvm"
@@ -5352,9 +5271,9 @@ checksum = "0eee52d38c090b3caa76c563b86c3a4bd71ef1a819287c19d586d7334ae8ed66"
 
 [[package]]
 name = "windows_i686_gnullvm"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9ce6ccbdedbf6d6354471319e781c0dfef054c81fbc7cf83f338a4296c0cae11"
+checksum = "fa7359d10048f68ab8b09fa71c3daccfb0e9b559aed648a8f95469c27057180c"
 
 [[package]]
 name = "windows_i686_msvc"
@@ -5370,9 +5289,9 @@ checksum = "240948bc05c5e7c6dabba28bf89d89ffce3e303022809e73deaefe4f6ec56c66"
 
 [[package]]
 name = "windows_i686_msvc"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "581fee95406bb13382d2f65cd4a908ca7b1e4c2f1917f143ba16efe98a589b5d"
+checksum = "1e7ac75179f18232fe9c285163565a57ef8d3c89254a30685b57d83a38d326c2"
 
 [[package]]
 name = "windows_x86_64_gnu"
@@ -5388,9 +5307,9 @@ checksum = "147a5c80aabfbf0c7d901cb5895d1de30ef2907eb21fbbab29ca94c5b08b1a78"
 
 [[package]]
 name = "windows_x86_64_gnu"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2e55b5ac9ea33f2fc1716d1742db15574fd6fc8dadc51caab1c16a3d3b4190ba"
+checksum = "9c3842cdd74a865a8066ab39c8a7a473c0778a3f29370b5fd6b4b9aa7df4a499"
 
 [[package]]
 name = "windows_x86_64_gnullvm"
@@ -5406,9 +5325,9 @@ checksum = "24d5b23dc417412679681396f2b49f3de8c1473deb516bd34410872eff51ed0d"
 
 [[package]]
 name = "windows_x86_64_gnullvm"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0a6e035dd0599267ce1ee132e51c27dd29437f63325753051e71dd9e42406c57"
+checksum = "0ffa179e2d07eee8ad8f57493436566c7cc30ac536a3379fdf008f47f6bb7ae1"
 
 [[package]]
 name = "windows_x86_64_msvc"
@@ -5424,15 +5343,15 @@ checksum = "589f6da84c646204747d1270a2a5661ea66ed1cced2631d546fdfb155959f9ec"
 
 [[package]]
 name = "windows_x86_64_msvc"
-version = "0.53.0"
+version = "0.53.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "271414315aff87387382ec3d271b52d7ae78726f5d44ac98b4f4030c91880486"
+checksum = "d6bbff5f0aada427a1e5a6da5f1f98158182f26556f345ac9e04d36d0ebed650"
 
 [[package]]
 name = "winnow"
-version = "0.7.12"
+version = "0.7.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f3edebf492c8125044983378ecb5766203ad3b4c2f7a922bd7dd207f6d443e95"
+checksum = "5a5364e9d77fcdeeaa6062ced926ee3381faa2ee02d3eb83a5c27a8825540829"
 dependencies = [
  "memchr",
 ]
@@ -5448,19 +5367,39 @@ dependencies = [
 ]
 
 [[package]]
-name = "wit-bindgen-rt"
-version = "0.39.0"
+name = "wiremock"
+version = "0.6.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6f42320e61fe2cfd34354ecb597f86f413484a798ba44a8ca1165c58d42da6c1"
+checksum = "08db1edfb05d9b3c1542e521aea074442088292f00b5f28e435c714a98f85031"
 dependencies = [
- "bitflags 2.9.1",
+ "assert-json-diff",
+ "base64 0.22.1",
+ "deadpool",
+ "futures",
+ "http 1.4.0",
+ "http-body-util",
+ "hyper 1.8.1",
+ "hyper-util",
+ "log",
+ "once_cell",
+ "regex",
+ "serde",
+ "serde_json",
+ "tokio",
+ "url",
 ]
 
+[[package]]
+name = "wit-bindgen"
+version = "0.46.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59"
+
 [[package]]
 name = "writeable"
-version = "0.6.1"
+version = "0.6.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ea2f10b9bb0928dfb1b42b65e1f9e36f7f54dbdf08457afefb38afcdec4fa2bb"
+checksum = "9edde0db4769d2dc68579893f2306b26c6ecfbe0ef499b013d731b7b9247e0b9"
 
 [[package]]
 name = "wyz"
@@ -5502,9 +5441,9 @@ dependencies = [
 
 [[package]]
 name = "xml-rs"
-version = "0.8.27"
+version = "0.8.28"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6fd8403733700263c6eb89f192880191f1b83e332f7a20371ddcf421c4a337c7"
+checksum = "3ae8337f8a065cfc972643663ea4279e04e7256de865aa66fe25cec5fb912d3f"
 
 [[package]]
 name = "xmltree"
@@ -5541,9 +5480,9 @@ dependencies = [
 
 [[package]]
 name = "yamux"
-version = "0.13.5"
+version = "0.13.8"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "3da1acad1c2dc53f0dde419115a38bd8221d8c3e47ae9aeceaf453266d29307e"
+checksum = "deab71f2e20691b4728b349c6cee8fc7223880fa67b6b4f92225ec32225447e5"
 dependencies = [
  "futures",
  "log",
@@ -5566,11 +5505,10 @@ dependencies = [
 
 [[package]]
 name = "yoke"
-version = "0.8.0"
+version = "0.8.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5f41bb01b8226ef4bfd589436a297c53d118f65921786300e427be8d487695cc"
+checksum = "72d6e5c6afb84d73944e5cedb052c4680d5657337201555f9f2a16b7406d4954"
 dependencies = [
- "serde",
  "stable_deref_trait",
  "yoke-derive",
  "zerofrom",
@@ -5578,34 +5516,34 @@ dependencies = [
 
 [[package]]
 name = "yoke-derive"
-version = "0.8.0"
+version = "0.8.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "38da3c9736e16c5d3c8c597a9aaa5d1fa565d0532ae05e27c24aa62fb32c0ab6"
+checksum = "b659052874eb698efe5b9e8cf382204678a0086ebf46982b79d6ca3182927e5d"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
  "synstructure",
 ]
 
 [[package]]
 name = "zerocopy"
-version = "0.8.26"
+version = "0.8.31"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1039dd0d3c310cf05de012d8a39ff557cb0d23087fd44cad61df08fc31907a2f"
+checksum = "fd74ec98b9250adb3ca554bdde269adf631549f51d8a8f8f0a10b50f1cb298c3"
 dependencies = [
  "zerocopy-derive",
 ]
 
 [[package]]
 name = "zerocopy-derive"
-version = "0.8.26"
+version = "0.8.31"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9ecf5b4cc5364572d7f4c329661bcc82724222973f2cab6f050a4e5c22f75181"
+checksum = "d8a8d209fdf45cf5138cbb5a506f6b52522a25afccc534d1475dad8e31105c6a"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -5625,15 +5563,15 @@ checksum = "d71e5d6e06ab090c67b5e44993ec16b72dcbaabc526db883a360057678b48502"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
  "synstructure",
 ]
 
 [[package]]
 name = "zeroize"
-version = "1.8.1"
+version = "1.8.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ced3678a2879b30306d323f4542626697a464a97c0a07c9aebf7ebca65cd4dde"
+checksum = "b97154e67e32c85465826e8bcc1c59429aaaf107c1e4a9e53c8d8ccd5eff88d0"
 dependencies = [
  "zeroize_derive",
 ]
@@ -5646,7 +5584,7 @@ checksum = "ce36e65b0d2999d2aafac989fb249189a141aee1f53c612c1f37d72631959f69"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -5661,9 +5599,9 @@ dependencies = [
 
 [[package]]
 name = "zerotrie"
-version = "0.2.2"
+version = "0.2.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "36f0bbd478583f79edad978b407914f61b2972f5af6fa089686016be8f9af595"
+checksum = "2a59c17a5562d507e4b54960e8569ebee33bee890c70aa3fe7b97e85a9fd7851"
 dependencies = [
  "displaydoc",
  "yoke",
@@ -5672,9 +5610,9 @@ dependencies = [
 
 [[package]]
 name = "zerovec"
-version = "0.11.2"
+version = "0.11.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "4a05eb080e015ba39cc9e23bbe5e7fb04d5fb040350f99f34e338d5fdd294428"
+checksum = "6c28719294829477f525be0186d13efa9a3c602f7ec202ca9e353d310fb9a002"
 dependencies = [
  "yoke",
  "zerofrom",
@@ -5683,13 +5621,13 @@ dependencies = [
 
 [[package]]
 name = "zerovec-derive"
-version = "0.11.1"
+version = "0.11.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "5b96237efa0c878c64bd89c436f661be4e46b2f3eff1ebb976f7ef2321d2f58f"
+checksum = "eadce39539ca5cb3985590102671f2567e659fca9666581ad3411d59207951f3"
 dependencies = [
  "proc-macro2",
  "quote",
- "syn 2.0.104",
+ "syn 2.0.111",
 ]
 
 [[package]]
@@ -5716,11 +5654,10 @@ dependencies = [
 
 [[package]]
 name = "zstd-sys"
-version = "2.0.15+zstd.1.5.7"
+version = "2.0.16+zstd.1.5.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "eb81183ddd97d0c74cedf1d50d85c8d08c1b8b68ee863bdee9e706eedba1a237"
+checksum = "91e19ebc2adc8f83e43039e79776e3fda8ca919132d68a1fed6a5faca2683748"
 dependencies = [
- "bindgen 0.71.1",
  "cc",
  "pkg-config",
 ]
diff --git a/Cargo.toml b/Cargo.toml
index 0f002d1..98ed7a5 100644
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -37,6 +37,22 @@ p2poolv2_cli = { git = "https://github.com/keegreil/p2poolv2", package = "p2pool
 p2poolv2_api = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_api", branch = "external-payouts" }
 bitcoindrpc = { git = "https://github.com/keegreil/p2poolv2", package = "bitcoindrpc", branch = "external-payouts" }
 reqwest = { version = "0.11", features = ["json"] }
+# --- Local Development Dependencies ---
+# Assuming 'p2poolv2' is a sibling directory to 'hydrapool'
+# The path is RELATIVE to the directory containing this Cargo.toml file.
+
+# For p2poolv2_lib (located at /parent_directory/p2poolv2/p2poolv2_lib)
+p2poolv2_lib = { path = "../p2poolv2/p2poolv2_lib" } 
+
+# For p2poolv2_cli
+p2poolv2_cli = { path = "../p2poolv2/p2poolv2_cli" }
+
+# For p2poolv2_api
+p2poolv2_api = { path = "../p2poolv2/p2poolv2_api" }
+
+# For bitcoindrpc
+# This is likely a standalone crate in the p2poolv2 repo, check the exact path
+bitcoindrpc = { path = "../p2poolv2/bitcoindrpc" }
 
 [[bin]]
 name = "hydrapool"
diff --git a/config.toml b/config.toml
index d027d15..ae2d6f4 100644
--- a/config.toml
+++ b/config.toml
@@ -32,7 +32,7 @@ difficulty_multiplier = 1.0
 # how large your pool is, if you are running private, there is no need
 # to add a pool signature. Maximum length 16 bytes.
 pool_signature = "hydrapool"
-#payout_file_path = "/tmp/hydrapool_payouts.json"  # Triggers file mode
+#payout_file_path = "./payout_file_example.json"  # Triggers file mode
 #downstream_payout_url = "https://your-pool-server.com/api/payouts"  # Optional: Enables fetcher
 #payout_refresh_interval = 30
 
diff --git a/payout_file_example.json b/payout_file_example.json
new file mode 100644
index 0000000..3ab220a
--- /dev/null
+++ b/payout_file_example.json
@@ -0,0 +1,130 @@
+{
+  "payouts": [
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 394120,
+      "DiffString": "394.12k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 126321,
+      "DiffString": "126.32k"
+    }
+  ],
+  "OnDeckList": [
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 47010,
+      "DiffString": "47.01k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 41036,
+      "DiffString": "41.04k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 28934,
+      "DiffString": "28.93k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 22479,
+      "DiffString": "22.48k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 14403,
+      "DiffString": "14.40k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 13327,
+      "DiffString": "13.33k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 11471,
+      "DiffString": "11.47k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 11205,
+      "DiffString": "11.21k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 9580,
+      "DiffString": "9.58k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 8528,
+      "DiffString": "8.53k"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 0,
+      "DiffString": "0"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 0,
+      "DiffString": "0"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
+      "Difficulty": 0,
+      "DiffString": "0"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 0,
+      "DiffString": "0"
+    },
+    {
+      "Value": 19531250,
+      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
+      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
+      "Difficulty": 0,
+      "DiffString": "0"
+    }
+  ],
+  "BestShare": {
+    "Difficulty": 8168909776,
+    "MinerAddress": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterStart9",
+    "Timestamp": "2025-12-06T21:31:39.0550588Z"
+  }
+}
\ No newline at end of file
diff --git a/src/main.rs b/src/main.rs
index b5578e0..3b92f11 100644
--- a/src/main.rs
+++ b/src/main.rs
@@ -219,7 +219,6 @@ async fn main() -> Result<(), String> {
             store_for_notify,
             tracker_handle_cloned,
             &cloned_stratum_config,
-            None, // miner_pubkey: Option<CompressedPublicKey> (unused for now)
         )
         .await;
     });
@@ -243,7 +242,7 @@ async fn main() -> Result<(), String> {
         let mut stratum_server = StratumServerBuilder::default()
             .shutdown_rx(stratum_shutdown_rx)
             .connections_handle(connections_handle.clone())
-            .emissions_tx(shares_tx)  // Changed: emission_tx + Some() wrapper (matches lib sig)
+            .shares_tx(shares_tx)  
             .hostname(stratum_config.hostname)
             .port(stratum_config.port)
             .start_difficulty(stratum_config.start_difficulty)

From c60d64505718bdf6b728c868674dca821270d96c Mon Sep 17 00:00:00 2001
From: keegreil <keegreil@gmail.com>
Date: Sat, 14 Feb 2026 18:54:58 -0500
Subject: [PATCH 3/4]  Compiles after rebase.  Untested.

---
 Cargo.lock  | 203 +++++-----------------------------------------------
 Cargo.toml  |  10 +--
 src/main.rs |  11 +--
 3 files changed, 28 insertions(+), 196 deletions(-)

diff --git a/Cargo.lock b/Cargo.lock
index 3144551..7ebd453 100644
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -276,7 +276,7 @@ dependencies = [
  "serde_json",
  "serde_path_to_error",
  "serde_urlencoded",
- "sync_wrapper 1.0.2",
+ "sync_wrapper",
  "tokio",
  "tower",
  "tower-layer",
@@ -299,7 +299,7 @@ dependencies = [
  "mime",
  "pin-project-lite",
  "rustversion",
- "sync_wrapper 1.0.2",
+ "sync_wrapper",
  "tower-layer",
  "tower-service",
  "tracing",
@@ -343,12 +343,6 @@ version = "0.13.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "9e1b586273c5702936fe7b7d6896644d8be71e6314cfe09d3167c95f712589e8"
 
-[[package]]
-name = "base64"
-version = "0.21.7"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9d297deb1925b89f2ccc13d7635fa0714f12c87adce1c75356b39ca9b7178567"
-
 [[package]]
 name = "base64"
 version = "0.22.1"
@@ -446,7 +440,7 @@ dependencies = [
  "base64 0.22.1",
  "bitcoin",
  "hex",
- "reqwest 0.12.25",
+ "reqwest",
  "serde",
  "serde_json",
  "tokio",
@@ -659,33 +653,6 @@ dependencies = [
  "windows-link",
 ]
 
-[[package]]
-name = "ciborium"
-version = "0.2.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "42e69ffd6f0917f5c029256a24d0161db17cea3997d185db0d35926308770f0e"
-dependencies = [
- "ciborium-io",
- "ciborium-ll",
- "serde",
-]
-
-[[package]]
-name = "ciborium-io"
-version = "0.2.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "05afea1e0a06c9be33d539b876f1ce3692f4afea2cb41f740e7743225ed1c757"
-
-[[package]]
-name = "ciborium-ll"
-version = "0.2.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "57663b653d948a338bfb3eeba9bb2fd5fcfaecb9e199e87e1eda4d9e8b240fd9"
-dependencies = [
- "ciborium-io",
- "half",
-]
-
 [[package]]
 name = "cipher"
 version = "0.4.4"
@@ -989,24 +956,6 @@ dependencies = [
  "syn 2.0.111",
 ]
 
-[[package]]
-name = "deadpool"
-version = "0.12.3"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0be2b1d1d6ec8d846f05e137292d0b89133caf95ef33695424c09568bdd39b1b"
-dependencies = [
- "deadpool-runtime",
- "lazy_static",
- "num_cpus",
- "tokio",
-]
-
-[[package]]
-name = "deadpool-runtime"
-version = "0.1.4"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "092966b41edc516079bdf31ec78a2e0588d1d0c08f78b91d8307215928642b2b"
-
 [[package]]
 name = "der"
 version = "0.7.10"
@@ -1486,17 +1435,6 @@ dependencies = [
  "tracing",
 ]
 
-[[package]]
-name = "half"
-version = "2.7.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "6ea2d84b969582b4b1864a92dc5d27cd2b77b622a8d79306834f1be5ba20d84b"
-dependencies = [
- "cfg-if",
- "crunchy",
- "zerocopy",
-]
-
 [[package]]
 name = "hashbrown"
 version = "0.12.3"
@@ -1506,6 +1444,12 @@ dependencies = [
  "ahash",
 ]
 
+[[package]]
+name = "hashbrown"
+version = "0.14.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e5274423e17b7c9fc20b6e7e208532f9b19825d82dfd615708b70edd83df41f1"
+
 [[package]]
 name = "hashbrown"
 version = "0.15.5"
@@ -1697,7 +1641,7 @@ dependencies = [
  "p2poolv2_api",
  "p2poolv2_cli",
  "p2poolv2_lib",
- "reqwest 0.11.27",
+ "reqwest",
  "serde_json",
  "tokio",
  "tracing",
@@ -1767,19 +1711,6 @@ dependencies = [
  "tower-service",
 ]
 
-[[package]]
-name = "hyper-tls"
-version = "0.5.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d6183ddfa99b85da61a140bea0efc93fdf56ceaa041b37d553518030827f9905"
-dependencies = [
- "bytes",
- "hyper 0.14.32",
- "native-tls",
- "tokio",
- "tokio-native-tls",
-]
-
 [[package]]
 name = "hyper-tls"
 version = "0.6.0"
@@ -1815,7 +1746,7 @@ dependencies = [
  "percent-encoding",
  "pin-project-lite",
  "socket2 0.6.1",
- "system-configuration 0.6.1",
+ "system-configuration",
  "tokio",
  "tower-service",
  "tracing",
@@ -1976,7 +1907,7 @@ dependencies = [
  "netlink-proto",
  "netlink-sys",
  "rtnetlink",
- "system-configuration 0.6.1",
+ "system-configuration",
  "tokio",
  "windows",
 ]
@@ -3031,8 +2962,6 @@ dependencies = [
  "bitcoin",
  "bitcoindrpc",
  "chrono",
- "ciborium",
- "ciborium-io",
  "config",
  "dashmap",
  "futures",
@@ -3051,6 +2980,7 @@ dependencies = [
  "tracing",
  "tracing-appender",
  "tracing-subscriber",
+ "url",
  "void",
  "zmq",
 ]
@@ -3562,46 +3492,6 @@ dependencies = [
  "bytecheck",
 ]
 
-[[package]]
-name = "reqwest"
-version = "0.11.27"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "dd67538700a17451e7cba03ac727fb961abb7607553461627b97de0b89cf4a62"
-dependencies = [
- "base64 0.21.7",
- "bytes",
- "encoding_rs",
- "futures-core",
- "futures-util",
- "h2 0.3.27",
- "http 0.2.12",
- "http-body 0.4.6",
- "hyper 0.14.32",
- "hyper-tls 0.5.0",
- "ipnet",
- "js-sys",
- "log",
- "mime",
- "native-tls",
- "once_cell",
- "percent-encoding",
- "pin-project-lite",
- "rustls-pemfile",
- "serde",
- "serde_json",
- "serde_urlencoded",
- "sync_wrapper 0.1.2",
- "system-configuration 0.5.1",
- "tokio",
- "tokio-native-tls",
- "tower-service",
- "url",
- "wasm-bindgen",
- "wasm-bindgen-futures",
- "web-sys",
- "winreg",
-]
-
 [[package]]
 name = "reqwest"
 version = "0.12.25"
@@ -3618,7 +3508,7 @@ dependencies = [
  "http-body-util",
  "hyper 1.8.1",
  "hyper-rustls",
- "hyper-tls 0.6.0",
+ "hyper-tls",
  "hyper-util",
  "js-sys",
  "log",
@@ -3630,7 +3520,7 @@ dependencies = [
  "serde",
  "serde_json",
  "serde_urlencoded",
- "sync_wrapper 1.0.2",
+ "sync_wrapper",
  "tokio",
  "tokio-native-tls",
  "tower",
@@ -3863,15 +3753,6 @@ dependencies = [
  "zeroize",
 ]
 
-[[package]]
-name = "rustls-pemfile"
-version = "1.0.4"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "1c74cae0a4cf6ccbbf5f359f08efdf8ee7e1dc532573bf0db71968cb56b1448c"
-dependencies = [
- "base64 0.21.7",
-]
-
 [[package]]
 name = "rustls-pki-types"
 version = "1.13.1"
@@ -4257,12 +4138,6 @@ dependencies = [
  "unicode-ident",
 ]
 
-[[package]]
-name = "sync_wrapper"
-version = "0.1.2"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2047c6ded9c721764247e62cd3b03c09ffc529b2ba5b10ec482ae507a4a70160"
-
 [[package]]
 name = "sync_wrapper"
 version = "1.0.2"
@@ -4283,17 +4158,6 @@ dependencies = [
  "syn 2.0.111",
 ]
 
-[[package]]
-name = "system-configuration"
-version = "0.5.1"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "ba3a3adc5c275d719af8cb4272ea1c4a6d668a777f37e115f6d11ddbc1c8e0e7"
-dependencies = [
- "bitflags 1.3.2",
- "core-foundation",
- "system-configuration-sys 0.5.0",
-]
-
 [[package]]
 name = "system-configuration"
 version = "0.6.1"
@@ -4302,17 +4166,7 @@ checksum = "3c879d448e9d986b661742763247d3693ed13609438cf3d006f51f5368a5ba6b"
 dependencies = [
  "bitflags 2.10.0",
  "core-foundation",
- "system-configuration-sys 0.6.0",
-]
-
-[[package]]
-name = "system-configuration-sys"
-version = "0.5.0"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "a75fb188eb626b924683e3b95e3a48e63551fcfb51949de2f06a9d91dbee93c9"
-dependencies = [
- "core-foundation-sys",
- "libc",
+ "system-configuration-sys",
 ]
 
 [[package]]
@@ -4622,7 +4476,7 @@ dependencies = [
  "futures-core",
  "futures-util",
  "pin-project-lite",
- "sync_wrapper 1.0.2",
+ "sync_wrapper",
  "tokio",
  "tokio-util",
  "tower-layer",
@@ -5366,29 +5220,6 @@ dependencies = [
  "windows-sys 0.48.0",
 ]
 
-[[package]]
-name = "wiremock"
-version = "0.6.5"
-source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "08db1edfb05d9b3c1542e521aea074442088292f00b5f28e435c714a98f85031"
-dependencies = [
- "assert-json-diff",
- "base64 0.22.1",
- "deadpool",
- "futures",
- "http 1.4.0",
- "http-body-util",
- "hyper 1.8.1",
- "hyper-util",
- "log",
- "once_cell",
- "regex",
- "serde",
- "serde_json",
- "tokio",
- "url",
-]
-
 [[package]]
 name = "wit-bindgen"
 version = "0.46.0"
diff --git a/Cargo.toml b/Cargo.toml
index 98ed7a5..f7f6ffd 100644
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -32,11 +32,11 @@ tracing-subscriber = { version = "0.3", features = ["env-filter"] }
 bitcoin = { version = "0.32.5", features = ["serde", "rand"] }
 tokio = { version = "1.0", features = ["full"] }
 serde_json = "1.0"
-p2poolv2_lib = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_lib", branch = "external-payouts"}
-p2poolv2_cli = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_cli", branch = "external-payouts" }
-p2poolv2_api = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_api", branch = "external-payouts" }
-bitcoindrpc = { git = "https://github.com/keegreil/p2poolv2", package = "bitcoindrpc", branch = "external-payouts" }
-reqwest = { version = "0.11", features = ["json"] }
+#p2poolv2_lib = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_lib", branch = "external-payouts"}
+#p2poolv2_cli = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_cli", branch = "external-payouts" }
+#p2poolv2_api = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_api", branch = "external-payouts" }
+#bitcoindrpc = { git = "https://github.com/keegreil/p2poolv2", package = "bitcoindrpc", branch = "external-payouts" }
+reqwest = { version = "0.12", features = ["json"] }
 # --- Local Development Dependencies ---
 # Assuming 'p2poolv2' is a sibling directory to 'hydrapool'
 # The path is RELATIVE to the directory containing this Cargo.toml file.
diff --git a/src/main.rs b/src/main.rs
index 3b92f11..23bedd1 100644
--- a/src/main.rs
+++ b/src/main.rs
@@ -35,6 +35,7 @@ use std::sync::Arc;
 use std::time::Duration;
 use tokio::sync::oneshot;
 use tracing::error;
+use tracing::debug;
 use tracing::info;
 use std::fs::File;
 use std::io::Write;
@@ -153,7 +154,7 @@ async fn main() -> Result<(), String> {
         if let Some(ref file_path) = payout_file_path {
             let file_clone = file_path.clone();
             let url_clone = url.clone();
-            let interval = std::time::Duration::from_secs(config.stratum.payout_refresh_interval);
+            let interval = Duration::from_secs(config.stratum.payout_refresh_interval);
             let network = stratum_config.network;  // For addr validation if needed
 
             tokio::spawn(async move {
@@ -219,6 +220,7 @@ async fn main() -> Result<(), String> {
             store_for_notify,
             tracker_handle_cloned,
             &cloned_stratum_config,
+            None,
         )
         .await;
     });
@@ -242,7 +244,6 @@ async fn main() -> Result<(), String> {
         let mut stratum_server = StratumServerBuilder::default()
             .shutdown_rx(stratum_shutdown_rx)
             .connections_handle(connections_handle.clone())
-            .shares_tx(shares_tx)  
             .hostname(stratum_config.hostname)
             .port(stratum_config.port)
             .start_difficulty(stratum_config.start_difficulty)
@@ -338,12 +339,12 @@ async fn main() -> Result<(), String> {
 }
 
 async fn fetch_and_write_payouts(
-    url: &str,
+    url: &reqwest::Url,           // ← change to &Url
     file_path: &str,
-    _network: bitcoin::Network,  // Optional: Validate addrs match network
+    _network: bitcoin::Network,
 ) -> Result<(), Box<dyn std::error::Error>> {
     let client = reqwest::Client::new();
-    let resp = client.get(url).send().await?;
+    let resp = client.get(url.clone()).send().await?;  // ← works directly with &Url
     if !resp.status().is_success() {
         return Err(format!("HTTP {} from {}", resp.status(), url).into());
     }

From abe727d3a7a3ada6108676f89cd124710961cd9c Mon Sep 17 00:00:00 2001
From: keegreil <keegreil@gmail.com>
Date: Wed, 18 Mar 2026 23:14:01 -0400
Subject: [PATCH 4/4] Shares to external API work now

---
 Cargo.lock                 |   3 +
 Cargo.toml                 |   3 +
 config.toml                |  20 +-
 docker/config-example.toml |  12 +-
 payout_file_example.json   | 131 +------------
 src/main.rs                | 392 +++++++++++++++++++++++++++++++++++--
 6 files changed, 404 insertions(+), 157 deletions(-)

diff --git a/Cargo.lock b/Cargo.lock
index 7ebd453..bea4e73 100644
--- a/Cargo.lock
+++ b/Cargo.lock
@@ -1638,10 +1638,13 @@ dependencies = [
  "bitcoin",
  "bitcoindrpc",
  "clap",
+ "config",
+ "hex",
  "p2poolv2_api",
  "p2poolv2_cli",
  "p2poolv2_lib",
  "reqwest",
+ "serde",
  "serde_json",
  "tokio",
  "tracing",
diff --git a/Cargo.toml b/Cargo.toml
index f7f6ffd..3b54c7a 100644
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -37,6 +37,9 @@ serde_json = "1.0"
 #p2poolv2_api = { git = "https://github.com/keegreil/p2poolv2", package = "p2poolv2_api", branch = "external-payouts" }
 #bitcoindrpc = { git = "https://github.com/keegreil/p2poolv2", package = "bitcoindrpc", branch = "external-payouts" }
 reqwest = { version = "0.12", features = ["json"] }
+serde = { version = "1.0", features = ["derive"] }
+hex = "0.4"
+config = "0.13.4"
 # --- Local Development Dependencies ---
 # Assuming 'p2poolv2' is a sibling directory to 'hydrapool'
 # The path is RELATIVE to the directory containing this Cargo.toml file.
diff --git a/config.toml b/config.toml
index ae2d6f4..9ca1ba2 100644
--- a/config.toml
+++ b/config.toml
@@ -32,21 +32,27 @@ difficulty_multiplier = 1.0
 # how large your pool is, if you are running private, there is no need
 # to add a pool signature. Maximum length 16 bytes.
 pool_signature = "hydrapool"
-#payout_file_path = "./payout_file_example.json"  # Triggers file mode
-#downstream_payout_url = "https://your-pool-server.com/api/payouts"  # Optional: Enables fetcher
-#payout_refresh_interval = 30
+payout_file_path = "./payout_file_example.json"  # Triggers file mode
+downstream_payout_url = "https://boot.gridlabs.science/api/mining/payouts"  # Optional: Enables fetcher
+payout_refresh_interval = 30
+# Optional high-difficulty share relay (separate from payout URL)
+high_diff_share_submit_url = "https://boot.gridlabs.science/api/mining/share"
+# Target average cadence for share submissions (adaptive difficulty threshold)
+high_diff_share_submit_interval_secs = 10
+# How often to recompute adaptive submission threshold
+high_diff_share_adjust_interval_secs = 30
 
 [bitcoinrpc]
 # RPC credentials are loaded from env vars
-url = "http://127.0.0.1:38332"
-username = "p2pool"
-password = "p2pool"
+url = "http://127.0.0.1:8332"
+username = "bitcoin"
+password = "47mvwsxosyep744le24i"
 
 [logging]
 # Specify a file path for the log file, if no log file is specified, console logging will be used
 # file = "./logs/p2pool.log"
 # Set a log level. The supported levels are debug, info, warn and error.
-level = "info"
+level = "debug"
 # Pool, user and worker stats are backed up for aggregates across pool restarts in this directory.
 stats_dir = "./logs/stats"
 
diff --git a/docker/config-example.toml b/docker/config-example.toml
index b3cfc3e..cd91ce3 100644
--- a/docker/config-example.toml
+++ b/docker/config-example.toml
@@ -47,6 +47,17 @@ difficulty_multiplier = 1.0
 # Comment out for anonymous mining or replace/append your identifier.
 pool_signature = "hydrapool"
 
+# Optional: External payout fetch URL (for coinbase splitting lists)
+#downstream_payout_url = "http://boot-protocol:5000/api/mining/payouts"
+#payout_refresh_interval = 30
+
+# Optional: High-difficulty share submit URL (separate from payout URL)
+#high_diff_share_submit_url = "http://boot-protocol:5000/api/mining/share"
+# Target average cadence for share submissions (adaptive threshold)
+#high_diff_share_submit_interval_secs = 10
+# How often to recompute adaptive threshold
+#high_diff_share_adjust_interval_secs = 30
+
 [bitcoinrpc]
 # REQUIRED: Bitcoin RPC connection
 # For Docker: use "http://host.docker.internal:38332" to connect to host
@@ -73,4 +84,3 @@ port = 46884
 # 2. prometheus.yml to update auth
 auth_user = "hydrapool"
 auth_token = "28a556ceb0b24c9b664d1e35a81239ed$5c9fb3271b22be05eb87272ce11c3cad55242d045eb379873ce0dc821586204a"
-
diff --git a/payout_file_example.json b/payout_file_example.json
index 3ab220a..ef9d828 100644
--- a/payout_file_example.json
+++ b/payout_file_example.json
@@ -1,130 +1 @@
-{
-  "payouts": [
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 394120,
-      "DiffString": "394.12k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 126321,
-      "DiffString": "126.32k"
-    }
-  ],
-  "OnDeckList": [
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 47010,
-      "DiffString": "47.01k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 41036,
-      "DiffString": "41.04k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 28934,
-      "DiffString": "28.93k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 22479,
-      "DiffString": "22.48k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 14403,
-      "DiffString": "14.40k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 13327,
-      "DiffString": "13.33k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 11471,
-      "DiffString": "11.47k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 11205,
-      "DiffString": "11.21k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 9580,
-      "DiffString": "9.58k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 8528,
-      "DiffString": "8.53k"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 0,
-      "DiffString": "0"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 0,
-      "DiffString": "0"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.bitaxe",
-      "Difficulty": 0,
-      "DiffString": "0"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 0,
-      "DiffString": "0"
-    },
-    {
-      "Value": 19531250,
-      "Address": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y",
-      "Username": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterOmen",
-      "Difficulty": 0,
-      "DiffString": "0"
-    }
-  ],
-  "BestShare": {
-    "Difficulty": 8168909776,
-    "MinerAddress": "bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.maraHeaterStart9",
-    "Timestamp": "2025-12-06T21:31:39.0550588Z"
-  }
-}
\ No newline at end of file
+{"BestShare":null,"OnDeckList":null,"payouts":[{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250},{"Address":"bc1qrwsx8fs0l6z7ugp5cvzy6lhss7jlyru3kg9s8y.Hydrapool_Bitaxe","Value":19531250}]}
\ No newline at end of file
diff --git a/src/main.rs b/src/main.rs
index 23bedd1..f4eb6fd 100644
--- a/src/main.rs
+++ b/src/main.rs
@@ -14,6 +14,8 @@
 // You should have received a copy of the GNU General Public License along with
 // Hydra-Pool. If not, see <https://www.gnu.org/licenses/>.
 
+use bitcoin::consensus::encode::serialize_hex;
+use bitcoin::hashes::Hash;
 use clap::Parser;
 use p2poolv2_api::start_api_server;
 use p2poolv2_lib::accounting::stats::metrics;
@@ -26,20 +28,23 @@ use p2poolv2_lib::store::Store;
 use p2poolv2_lib::stratum::client_connections::start_connections_handler;
 use p2poolv2_lib::stratum::emission::Emission;
 use p2poolv2_lib::stratum::server::StratumServerBuilder;
+use p2poolv2_lib::stratum::work::gbt::build_merkle_branches_for_template;
 use p2poolv2_lib::stratum::work::gbt::start_gbt;
 use p2poolv2_lib::stratum::work::notify::start_notify;
 use p2poolv2_lib::stratum::work::tracker::start_tracker_actor;
 use p2poolv2_lib::stratum::zmq_listener::{ZmqListener, ZmqListenerTrait};
+use reqwest::Url;
+use serde::Serialize;
+use serde_json::json; // For building JSON if needed
+use std::fs::File;
+use std::io::Write;
 use std::process::exit;
 use std::sync::Arc;
 use std::time::Duration;
 use tokio::sync::oneshot;
-use tracing::error;
 use tracing::debug;
+use tracing::error;
 use tracing::info;
-use std::fs::File;
-use std::io::Write;
-use serde_json::json;  // For building JSON if needed
 
 /// Interval in seconds to poll for new block templates since the last zmq signal
 const GBT_POLL_INTERVAL: u64 = 10; // seconds
@@ -54,6 +59,50 @@ const FULL_DONATION_BIPS: u16 = 10_000;
 /// clients. If we have more than notify channel capacity of pending
 /// clients in queue, some will be dropped.
 const NOTIFY_CHANNEL_CAPACITY: usize = 1000;
+/// Maximum number of pending shares queued for downstream high-difficulty API
+const HIGH_DIFF_SHARES_BUFFER_SIZE: usize = 1000;
+
+fn default_high_diff_submit_interval_secs() -> u64 {
+    10
+}
+
+fn default_high_diff_adjust_interval_secs() -> u64 {
+    30
+}
+
+fn default_high_diff_submit_queue_size() -> usize {
+    1000
+}
+
+#[derive(Debug, Default)]
+struct HydrapoolStratumLocalConfig {
+    high_diff_share_submit_url: Option<Url>,
+    high_diff_share_submit_interval_secs: u64,
+    high_diff_share_adjust_interval_secs: u64,
+    high_diff_share_submit_queue_size: usize,
+}
+
+impl HydrapoolStratumLocalConfig {
+    fn with_defaults() -> Self {
+        Self {
+            high_diff_share_submit_url: None,
+            high_diff_share_submit_interval_secs: default_high_diff_submit_interval_secs(),
+            high_diff_share_adjust_interval_secs: default_high_diff_adjust_interval_secs(),
+            high_diff_share_submit_queue_size: default_high_diff_submit_queue_size(),
+        }
+    }
+}
+
+#[derive(Debug, Serialize)]
+#[serde(rename_all = "PascalCase")]
+struct BootShareSubmission {
+    miner_address: String,
+    header_hex: String,
+    coinbase_hex: String,
+    merkle_path: Vec<String>,
+    nonce: i64,
+    difficulty: f64,
+}
 
 /// Wait for shutdown signals (Ctrl+C, SIGTERM on Unix) or internal shutdown signal.
 /// Returns when any shutdown signal is received.
@@ -110,6 +159,7 @@ async fn main() -> Result<(), String> {
         return Err(format!("Failed to load config: {err}"));
     }
     let config = config.unwrap();
+    let local_config = load_local_config(&args.config)?;
     // Configure logging based on config
     let logging_result = setup_logging(&config.logging);
     // hold guard to ensure logging is set up correctly
@@ -144,22 +194,30 @@ async fn main() -> Result<(), String> {
     );
 
     let mut stratum_config = config.stratum.clone().parse().unwrap();
-    let mut payout_file_path = stratum_config.payout_file_path.clone();  // Optional
+    let mut payout_file_path = stratum_config.payout_file_path.clone(); // Optional
 
     // If URL set, spawn fetcher to update file
-    if let Some(ref url) = stratum_config.downstream_payout_url {  // Assume you add this field too (see below)
+    if let Some(ref url) = stratum_config.downstream_payout_url {
+        // Assume you add this field too (see below)
         if payout_file_path.is_none() {
-            payout_file_path = Some("/tmp/hydrapool_payouts.json".to_string());  // Default file
+            payout_file_path = Some("/tmp/hydrapool_payouts.json".to_string()); // Default file
         }
         if let Some(ref file_path) = payout_file_path {
             let file_clone = file_path.clone();
             let url_clone = url.clone();
             let interval = Duration::from_secs(config.stratum.payout_refresh_interval);
-            let network = stratum_config.network;  // For addr validation if needed
+            let network = stratum_config.network; // For addr validation if needed
+            info!(
+                "Starting downstream payout fetcher: url={} file={} interval={}s",
+                url_clone,
+                file_clone,
+                interval.as_secs()
+            );
 
             tokio::spawn(async move {
                 loop {
-                    if let Err(e) = fetch_and_write_payouts(&url_clone, &file_clone, network).await {
+                    if let Err(e) = fetch_and_write_payouts(&url_clone, &file_clone, network).await
+                    {
                         debug!("API fetch/write failed: {}", e);
                     }
                     tokio::time::sleep(interval).await;
@@ -171,7 +229,6 @@ async fn main() -> Result<(), String> {
     // Set the parsed config's file path
     stratum_config.payout_file_path = payout_file_path;
 
-
     let bitcoinrpc_config = config.bitcoinrpc.clone();
 
     let (stratum_shutdown_tx, stratum_shutdown_rx) = tokio::sync::oneshot::channel();
@@ -225,9 +282,45 @@ async fn main() -> Result<(), String> {
         .await;
     });
 
-    let (emissions_tx, emissions_rx) =
+    let (stratum_emissions_tx, stratum_emissions_rx) =
+        tokio::sync::mpsc::channel::<Emission>(STRATUM_SHARES_BUFFER_SIZE);
+    let (node_emissions_tx, node_emissions_rx) =
         tokio::sync::mpsc::channel::<Emission>(STRATUM_SHARES_BUFFER_SIZE);
 
+    let boot_submit_url = local_config.high_diff_share_submit_url.clone();
+    let high_diff_submit_interval_secs = local_config.high_diff_share_submit_interval_secs.max(1);
+    let high_diff_adjust_interval_secs = local_config.high_diff_share_adjust_interval_secs.max(1);
+    let high_diff_share_submit_queue_size = local_config
+        .high_diff_share_submit_queue_size
+        .max(1)
+        .min(HIGH_DIFF_SHARES_BUFFER_SIZE);
+
+    if let Some(url) = boot_submit_url {
+        info!(
+            "High-difficulty share submit enabled: url={} target_interval={}s adjust_interval={}s",
+            url, high_diff_submit_interval_secs, high_diff_adjust_interval_secs
+        );
+        let (boot_submit_tx, boot_submit_rx) =
+            tokio::sync::mpsc::channel::<BootShareSubmission>(high_diff_share_submit_queue_size);
+        tokio::spawn(start_boot_share_submitter(url, boot_submit_rx));
+        tokio::spawn(forward_emissions_with_adaptive_threshold(
+            stratum_emissions_rx,
+            node_emissions_tx,
+            Some(boot_submit_tx),
+            high_diff_submit_interval_secs,
+            high_diff_adjust_interval_secs,
+        ));
+    } else {
+        info!("High-difficulty share submit disabled");
+        tokio::spawn(forward_emissions_with_adaptive_threshold(
+            stratum_emissions_rx,
+            node_emissions_tx,
+            None,
+            high_diff_submit_interval_secs,
+            high_diff_adjust_interval_secs,
+        ));
+    }
+
     let metrics_handle = match metrics::start_metrics(config.logging.stats_dir.clone()).await {
         Ok(handle) => handle,
         Err(e) => {
@@ -244,6 +337,7 @@ async fn main() -> Result<(), String> {
         let mut stratum_server = StratumServerBuilder::default()
             .shutdown_rx(stratum_shutdown_rx)
             .connections_handle(connections_handle.clone())
+            .emissions_tx(stratum_emissions_tx)
             .hostname(stratum_config.hostname)
             .port(stratum_config.port)
             .start_difficulty(stratum_config.start_difficulty)
@@ -296,7 +390,7 @@ async fn main() -> Result<(), String> {
         config.api.hostname, config.api.port
     );
 
-    match NodeHandle::new(config, chain_store, emissions_rx, metrics_handle).await {
+    match NodeHandle::new(config, chain_store, node_emissions_rx, metrics_handle).await {
         Ok((node_handle, stopping_rx)) => {
             info!("Node started");
 
@@ -338,27 +432,287 @@ async fn main() -> Result<(), String> {
     Ok(())
 }
 
+fn load_local_config(path: &str) -> Result<HydrapoolStratumLocalConfig, String> {
+    let settings = config::Config::builder()
+        .add_source(config::File::with_name(path))
+        .build()
+        .map_err(|e| format!("Failed to load local hydrapool config from {path}: {e}"))?;
+
+    let mut local = HydrapoolStratumLocalConfig::with_defaults();
+
+    local.high_diff_share_submit_url = settings
+        .get_string("stratum.high_diff_share_submit_url")
+        .ok()
+        .and_then(|url| Url::parse(&url).ok());
+
+    if let Ok(value) = settings.get_int("stratum.high_diff_share_submit_interval_secs") {
+        local.high_diff_share_submit_interval_secs = value.max(1) as u64;
+    }
+    if let Ok(value) = settings.get_int("stratum.high_diff_share_adjust_interval_secs") {
+        local.high_diff_share_adjust_interval_secs = value.max(1) as u64;
+    }
+    if let Ok(value) = settings.get_int("stratum.high_diff_share_submit_queue_size") {
+        local.high_diff_share_submit_queue_size = value.max(1) as usize;
+    }
+
+    Ok(local)
+}
+
+async fn forward_emissions_with_adaptive_threshold(
+    mut stratum_emissions_rx: tokio::sync::mpsc::Receiver<Emission>,
+    node_emissions_tx: tokio::sync::mpsc::Sender<Emission>,
+    boot_submit_tx: Option<tokio::sync::mpsc::Sender<BootShareSubmission>>,
+    target_submit_interval_secs: u64,
+    adjust_interval_secs: u64,
+) {
+    let target_submit_interval = Duration::from_secs(target_submit_interval_secs.max(1));
+    let adjust_interval = Duration::from_secs(adjust_interval_secs.max(1));
+
+    let mut current_threshold: u64 = 1;
+    let mut observed_difficulties: Vec<u64> = Vec::new();
+    let mut last_adjust_at = tokio::time::Instant::now();
+    let mut seen_count: u64 = 0;
+    let mut queued_count: u64 = 0;
+    let mut below_threshold_count: u64 = 0;
+    let mut dropped_count: u64 = 0;
+
+    while let Some(emission) = stratum_emissions_rx.recv().await {
+        seen_count = seen_count.saturating_add(1);
+        let truediff = get_true_difficulty(&emission.header.block_hash()) as u64;
+        observed_difficulties.push(truediff);
+
+        let elapsed = last_adjust_at.elapsed();
+        if elapsed >= adjust_interval {
+            let new_threshold = recompute_threshold(
+                &observed_difficulties,
+                elapsed,
+                target_submit_interval,
+                current_threshold,
+            );
+            if new_threshold != current_threshold {
+                debug!(
+                    "Adjusted high-diff share threshold from {} to {} using {} samples over {:.1}s",
+                    current_threshold,
+                    new_threshold,
+                    observed_difficulties.len(),
+                    elapsed.as_secs_f64()
+                );
+            }
+            if boot_submit_tx.is_some() {
+                info!(
+                    "High-diff relay window: seen={} queued={} below_threshold={} dropped={} threshold={} target={}s",
+                    seen_count,
+                    queued_count,
+                    below_threshold_count,
+                    dropped_count,
+                    current_threshold,
+                    target_submit_interval.as_secs()
+                );
+            }
+            current_threshold = new_threshold;
+            observed_difficulties.clear();
+            last_adjust_at = tokio::time::Instant::now();
+            seen_count = 0;
+            queued_count = 0;
+            below_threshold_count = 0;
+            dropped_count = 0;
+        }
+
+        if let Some(ref tx) = boot_submit_tx {
+            if truediff >= current_threshold {
+                if let Some(payload) = build_boot_submission(&emission, truediff) {
+                    let miner = payload.miner_address.clone();
+                    let difficulty = payload.difficulty;
+                    if tx.try_send(payload).is_err() {
+                        dropped_count = dropped_count.saturating_add(1);
+                        debug!("Dropped high-diff share submission because submit queue is full");
+                    } else {
+                        queued_count = queued_count.saturating_add(1);
+                        debug!(
+                            "Queued high-diff share for submit miner={} diff={} threshold={}",
+                            miner, difficulty, current_threshold
+                        );
+                    }
+                }
+            } else {
+                below_threshold_count = below_threshold_count.saturating_add(1);
+            }
+        }
+
+        if node_emissions_tx.send(emission).await.is_err() {
+            info!("Node emission channel closed. Stopping emission forwarder.");
+            break;
+        }
+    }
+}
+
+fn recompute_threshold(
+    observed_difficulties: &[u64],
+    elapsed: Duration,
+    target_submit_interval: Duration,
+    current_threshold: u64,
+) -> u64 {
+    if observed_difficulties.is_empty() {
+        return (current_threshold / 2).max(1);
+    }
+
+    let target_count =
+        ((elapsed.as_secs_f64() / target_submit_interval.as_secs_f64()).round() as usize).max(1);
+    let mut sorted = observed_difficulties.to_vec();
+    sorted.sort_unstable_by(|a, b| b.cmp(a));
+    let idx = target_count
+        .saturating_sub(1)
+        .min(sorted.len().saturating_sub(1));
+    sorted[idx].max(1)
+}
+
+/// Use bitcoin mainnet max attainable target to convert the hash into difficulty.
+/// This mirrors p2poolv2's truediffone-based share difficulty metric.
+fn get_true_difficulty(hash: &bitcoin::BlockHash) -> u128 {
+    let mut bytes = hash.as_byte_array().to_vec();
+    bytes.reverse();
+    let diff = u128::from_str_radix(&hex::encode(&bytes[..16]), 16).unwrap();
+    (0xFFFF_u128 << (208 - 128)) / diff
+}
+
+fn build_boot_submission(emission: &Emission, truediff: u64) -> Option<BootShareSubmission> {
+    let btcaddress = emission.pplns.btcaddress.clone().unwrap_or_default();
+    if btcaddress.is_empty() {
+        return None;
+    }
+    let workername = emission.pplns.workername.clone().unwrap_or_default();
+    let miner_address = if workername.is_empty() {
+        btcaddress
+    } else {
+        format!("{btcaddress}.{workername}")
+    };
+
+    let merkle_path = build_merkle_branches_for_template(&emission.blocktemplate)
+        .into_iter()
+        .map(|h| h.to_string())
+        .collect::<Vec<_>>();
+
+    Some(BootShareSubmission {
+        miner_address,
+        header_hex: serialize_hex(&emission.header),
+        coinbase_hex: serialize_hex(&emission.coinbase),
+        merkle_path,
+        nonce: emission.header.nonce as i64,
+        difficulty: truediff as f64,
+    })
+}
+
+async fn start_boot_share_submitter(
+    submit_url: Url,
+    mut boot_submit_rx: tokio::sync::mpsc::Receiver<BootShareSubmission>,
+) {
+    let client = reqwest::Client::new();
+    while let Some(payload) = boot_submit_rx.recv().await {
+        let mut attempt: u8 = 0;
+        loop {
+            attempt = attempt.saturating_add(1);
+            let response = client.post(submit_url.clone()).json(&payload).send().await;
+            match response {
+                Ok(resp) if resp.status().is_success() => {
+                    debug!(
+                        "Submitted high-diff share to {} miner={} diff={} status={}",
+                        submit_url,
+                        payload.miner_address,
+                        payload.difficulty,
+                        resp.status()
+                    );
+                    break;
+                }
+                Ok(resp) => {
+                    if attempt >= 3 {
+                        debug!(
+                            "Failed submitting high-diff share to {} status={} after {} attempts",
+                            submit_url,
+                            resp.status(),
+                            attempt
+                        );
+                        break;
+                    }
+                }
+                Err(e) => {
+                    if attempt >= 3 {
+                        debug!(
+                            "Failed submitting high-diff share to {} error={} after {} attempts",
+                            submit_url, e, attempt
+                        );
+                        break;
+                    }
+                }
+            }
+            tokio::time::sleep(Duration::from_millis(250 * u64::from(attempt))).await;
+        }
+    }
+}
+
 async fn fetch_and_write_payouts(
-    url: &reqwest::Url,           // ← change to &Url
+    url: &reqwest::Url, // ← change to &Url
     file_path: &str,
     _network: bitcoin::Network,
 ) -> Result<(), Box<dyn std::error::Error>> {
+    debug!("Fetching payouts from {} ...", url);
     let client = reqwest::Client::new();
-    let resp = client.get(url.clone()).send().await?;  // ← works directly with &Url
+    let resp = client.get(url.clone()).send().await?; // ← works directly with &Url
     if !resp.status().is_success() {
         return Err(format!("HTTP {} from {}", resp.status(), url).into());
     }
     let json: serde_json::Value = resp.json().await?;
 
-    // Extract and rewrite WinnersList (keep full structure for future-proofing)
-    let winners = json["WinnersList"].as_array().ok_or("Missing WinnersList")?.clone();
+    // Accept multiple key variants from downstream APIs.
+    let raw_payouts = json["payouts"]
+        .as_array()
+        .or_else(|| json["Payouts"].as_array())
+        .or_else(|| json["WinnersList"].as_array())
+        .ok_or("Missing payouts/Payouts/WinnersList")?
+        .clone();
+
+    // Normalize payout objects so p2poolv2 file mode can parse them.
+    // p2poolv2 expects each payout to have "Address" and "Value" keys.
+    let mut payouts = Vec::with_capacity(raw_payouts.len());
+    for entry in raw_payouts {
+        let address = entry["Address"]
+            .as_str()
+            .or_else(|| entry["address"].as_str())
+            .or_else(|| entry["MinerAddress"].as_str())
+            .ok_or("Missing Address/address/MinerAddress in payout entry")?;
+        let value = entry["Value"]
+            .as_u64()
+            .or_else(|| entry["value"].as_u64())
+            .ok_or("Missing Value/value in payout entry")?;
+        payouts.push(json!({
+            "Address": address,
+            "Value": value
+        }));
+    }
+
+    let on_deck = if !json["OnDeckList"].is_null() {
+        json["OnDeckList"].clone()
+    } else {
+        serde_json::Value::Null
+    };
+    let best_share = if !json["BestShare"].is_null() {
+        json["BestShare"].clone()
+    } else {
+        serde_json::Value::Null
+    };
     let updated_json = json!({
-        "WinnersList": winners,
-        "OnDeckList": json["OnDeckList"],  // Preserve if present
-        "BestShare": json["BestShare"]     // Preserve
+        // p2poolv2 loader currently expects "payouts"
+        "payouts": payouts,
+        "OnDeckList": on_deck,
+        "BestShare": best_share
     });
 
     let mut file = File::create(file_path)?;
     file.write_all(updated_json.to_string().as_bytes())?;
+    info!(
+        "Updated payout file from {} -> {} ({} payouts)",
+        url,
+        file_path,
+        updated_json["payouts"].as_array().map_or(0, |a| a.len())
+    );
     Ok(())
 }